
CAS Number2234-13-1
SynonymsOctachloronaphthalene; Perna; PCN-75; MFCD00145026; Octachlornaphthalen; octachloro-naphthalene; EINECS 218-778-7; perchloronaphthalene; octachloronaphtalene; 1,2,3,4,5,6,7,8-OCTACHLORONAPHTHALENE; HALOWAX 1051; octachloro-naphthalen
Molecular FormulaC10Cl8
Molecular Weight403.731
Purity98.00%
Density1.8±0.1 g/cm3
Boiling Point424.7±40.0 °C at 760 mmHg
Melting Point185ºC
AppearanceLight yellow solid with an aromatic odor
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2234-13-1 |
| Catalog No. | 2A-9028190 |
| Chinese Name | 八氯化萘 |
| Synonyms | Octachloronaphthalene; Perna; PCN-75; MFCD00145026; Octachlornaphthalen; octachloro-naphthalene; EINECS 218-778-7; perchloronaphthalene; octachloronaphtalene; 1,2,3,4,5,6,7,8-OCTACHLORONAPHTHALENE; HALOWAX 1051; octachloro-naphthalen |
| Molecular Formula | C10Cl8 |
| Molecular Weight | 403.731 |
| Purity | 98.00 |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 424.7±40.0 °C at 760 mmHg |
| Melting Point | 185ºC |
| Appearance | Light yellow solid with an aromatic odor |
| Water Solubility | Insoluble |
| Storage Condition | Warehouse ventilation and low temperature drying |
| HTC | 2903999090 |
| SMILES | Clc1c(Cl)c(Cl)c2c(Cl)c(Cl)c(Cl)c(Cl)c2c1Cl |
| InChI | InChI=1S/C10Cl8/c11-3-1-2(5(13)9(17)7(3)15)6(14)10(18)8(16)4(1)12 |
| InChI Key | RTNLUFLDZOAXIC-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-tert-Butyl-6-methylphenol | 2219-82-1 | 2A-9028175 |
| 4-(1H-Imidazol-1-yl)aniline | 2221-00-3 | 2A-9028176 |
| Cadmium stearate | 2223-93-0 | 2A-9028180 |
| 2-Ethoxy-1-naphthoic acid | 2224-00-2 | 2A-9028181 |
| Menthyl formate | 2230-90-2 | 2A-9028186 |
| 2',4'-Dichloroacetophenone | 2234-16-4 | 2A-9028191 |
| 1-Acenaphthenone | 2235-15-6 | 2A-9028193 |
| [Nitrilotris(methylene)]tris-phosphonic acid pentasodium salt | 2235-43-0 | 2A-9028194 |
| N,N-Diethylacetoacetamide | 2235-46-3 | 2A-9028195 |
| 2-Amino-4-hydroxy-1H-pteridine | 2236-60-4 | 2A-9028197 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA