
CAS Number2212-81-9
SynonymsLuperox 802; 1,3-bis(t-butylperoxyisopropyl)benzene; 1,3-Bis-(2-tert-butylperoxiisopropyl)benzol; 1,3-Bis{2-[(2-methyl-2-propanyl)peroxy]-2-propanyl}benzene; Perbutyl PT; BIBP; Perkadox14S; 1,3-BIS(TERT-BUTYLDIOXYISOPROPYL)BENZENE; LINKWELL BIPB; 14s; m-bis-(2-tert-Butylperoxy-2-propyl)benzene; 1,3-Bis(tert-butylperoxyisopropyl)benzene; Peroximon F; Perhexa F 40; PEROXAN BIB; [1,3-phenylenebis(1-methylethylidene)]bis[tert-butyl] peroxide; EINECS 218-664-7
Molecular FormulaC20H34O4
Molecular Weight372.55
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point360.1±35.0 °C at 760 mmHg
Melting Point43-49ºC
AppearanceWhite to slightly yellow tablets
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2212-81-9 |
| Catalog No. | 2A-9028154 |
| Chinese Name | 无味dcp |
| Synonyms | Luperox 802; 1,3-bis(t-butylperoxyisopropyl)benzene; 1,3-Bis-(2-tert-butylperoxiisopropyl)benzol; 1,3-Bis{2-[(2-methyl-2-propanyl)peroxy]-2-propanyl}benzene; Perbutyl PT; BIBP; Perkadox14S; 1,3-BIS(TERT-BUTYLDIOXYISOPROPYL)BENZENE; LINKWELL BIPB; 14s; m-bis-(2-tert-Butylperoxy-2-propyl)benzene; 1,3-Bis(tert-butylperoxyisopropyl)benzene; Peroximon F; Perhexa F 40; PEROXAN BIB; [1,3-phenylenebis(1-methylethylidene)]bis[tert-butyl] peroxide; EINECS 218-664-7 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 372.55 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 360.1±35.0 °C at 760 mmHg |
| Melting Point | 43-49ºC |
| Appearance | White to slightly yellow tablets |
| Storage Condition | Store airtight in a cool, dry warehouse. Keep away |
| Packaging | II |
| HTC | 2909600000 |
| PubChem ID | 7744451 |
| SMILES | CC(C)(C)OOC(C)(C)c1cccc(C(C)(C)OOC(C)(C)C)c1 |
| InChI | InChI=1S/C20H34O4/c1-17(2,3)21-23-19(7,8)15-12-11-13-16(14-15)20(9,10)24-22-18(4,5)6/h11-14H,1-10H3 |
| InChI Key | UBRWPVTUQDJKCC-UHFFFAOYSA-N |
| Hazard Symbols | 5.2 |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2909600000 alcohol peroxides, ether peroxides, ketone peroxides and their halogenated, sulphonated, nitrated or nitrosated derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(Dimethylamino)ethyl benzoate | 2208-05-1 | 2A-9028142 |
| Ethyl acetimidate hydrochloride | 2208-07-3 | 2A-9028143 |
| N-Phenylacrylamide | 2210-24-4 | 2A-9028144 |
| N-Isopropylacrylamide | 2210-25-5 | 2A-9028145 |
| Guaiacol glycidyl ether | 2210-74-4 | 2A-9028146 |
| 2-Chloro-5-(1,1-dimethylethyl)-1,3-dinitrobenzene | 2213-81-2 | 2A-9028157 |
| N,N'-Bis(2-chloroethyl)urea | 2214-72-4 | 2A-9028158 |
| 4-Phenoxybenzoic acid | 2215-77-2 | 2A-9028160 |
| 2-Nitrophenyl phenyl ether | 2216-12-8 | 2A-9028162 |
| 4-Methylbenzyl acetate | 2216-45-7 | 2A-9028163 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA