
CAS Number2210-93-7
Synonyms1-Phenylpiperazinium chloride; 1-Phenylpiperazine hydrochloride; Phenobolin hydrochloride; 1-Phenylpiperazine HCl; Piperazine,1-phenyl-,hydrochloride; 4-phenylpiperazine hydrochloride; MFCD00012758; EINECS 218-646-9; phenylpiperazine,chloride; phenylpiperazine hydrochloride; 1-phenylpiperazine dihydrochloride; 1-phenylpiperazin-1-ium chloride; N-phenyl-piperazine hydrochloride; 1-PHENYL PIPERAZINE HYDROCHLORIDE
Molecular FormulaC10H15ClN2
Molecular Weight198.69200
Purity98.00%
Density1.028g/cm3
Boiling Point245 - 250ºC
Melting Point247-250 °C(lit.)
AppearanceWhite to off-white crystalline powder
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2210-93-7 |
| Catalog No. | 2A-9028148 |
| Chinese Name | 1-苯基哌嗪盐酸盐 |
| Synonyms | 1-Phenylpiperazinium chloride; 1-Phenylpiperazine hydrochloride; Phenobolin hydrochloride; 1-Phenylpiperazine HCl; Piperazine,1-phenyl-,hydrochloride; 4-phenylpiperazine hydrochloride; MFCD00012758; EINECS 218-646-9; phenylpiperazine,chloride; phenylpiperazine hydrochloride; 1-phenylpiperazine dihydrochloride; 1-phenylpiperazin-1-ium chloride; N-phenyl-piperazine hydrochloride; 1-PHENYL PIPERAZINE HYDROCHLORIDE |
| Molecular Formula | C10H15ClN2 |
| Molecular Weight | 198.69200 |
| Purity | 98.00 |
| Density | 1.028g/cm3 |
| Boiling Point | 245 - 250ºC |
| Melting Point | 247-250 °C(lit.) |
| Appearance | White to off-white crystalline powder |
| Storage Condition | Keep container sealed, placed in a tight-fitting c |
| Packaging | III |
| HTC | 2933599090 |
| PubChem ID | 545464 |
| SMILES | Cl.c1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C10H14N2.ClH/c1-2-4-10(5-3-1)12-8-6-11-7-9-12;/h1-5,11H,6-9H2;1H |
| InChI Key | NQNZNONJZASOKL-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| MSDS | msds/28148_1_2210_93_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4-Amino-2-methylthiopyrimidine | 2183-66-6 | 2A-9028114 |
| Ethyl pyrrole-2-carboxylate | 2199-43-1 | 2A-9028129 |
| Ethyl 3,5-dimethyl-1H-pyrrole-2-carboxylate | 2199-44-2 | 2A-9028130 |
| Ethyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate | 2199-47-5 | 2A-9028131 |
| 2-[(2-Methylphenoxy)methyl]oxirane | 2210-79-9 | 2A-9028147 |
| 1-Aminopiperidine | 2213-43-6 | 2A-9028155 |
| 1-[(4-Methylphenyl)sulfonyl]-1H-imidazole | 2232-08-8 | 2A-9028188 |
| 2-Methyl-5-pyrimidinemethanol | 2239-83-0 | 2A-9028200 |
| 4-Amino-3-fluoropyridine | 2247-88-3 | 2A-9028215 |
| 1-(4-Fluorophenyl)piperazine | 2252-63-3 | 2A-9028224 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA