
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 261762-39-4 |
| Catalog No. | 2A-9002805 |
| Chinese Name | 2-氯-3,6-二氟苯甲醛 |
| Synonyms | VHR BG CF FF; 2-Chloro-3,6-difluorobenzaldehyde; MFCD01631443 |
| Molecular Formula | C7H3ClF2O |
| Molecular Weight | 176.548 |
| Purity | 97 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 206.4±35.0 °C at 760 mmHg |
| Melting Point | 46-50 °C(lit.) |
| Storage Condition | Storage: Sealed, cool, ventilated and dry |
| HTC | 2913000090 |
| SMILES | O=Cc1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C7H3ClF2O/c8-7-4(3-11)5(9)1-2-6(7)10/h1-3H |
| InChI Key | KPYBGKSDBNMHTO-UHFFFAOYSA-N |
| Hazard Symbols | Xi |
| Risk Codes | R36/37/38 |
| Safety Description | S26-36 |
| MSDS | msds/2805_1_261762_39_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-Chloro-1,1,2-trifluoroethyl difluoromethyl ether | 13838-16-9 | 2A-9002778 |
| 2-Chloro-3-(trifluoromethyl)benzaldehyde | 93118-03-7 | 2A-9002793 |
| 2-Chloro-3-(trifluoromethyl)benzamide | 2A-102794 | 2A-9002794 |
| 2-Chloro-3-(trifluoromethyl)benzoic acid | 39226-97-6 | 2A-9002795 |
| 2-Chloro-3-(trifluoromethyl)benzoyl chloride | 850156-39-7 | 2A-9002796 |
| 2-Chloro-3-fluorobenzaldehyde | 2A-102813 | 2A-9002813 |
| 2-Chloro-3-fluoromethylbenzaldehyde | 916791-72-5 | 2A-9002815 |
| 2-Chloro-3-quinolinecarboxaldehyde oxime | 93299-49-1 | 2A-9002826 |
| 2-Chloro-4-(trifluoromethyl)benzenesulphonylchloride | 175205-54-6 | 2A-9002828 |
| 2-Chloro-4-(trifluoromethyl)phenol | 35852-58-5 | 2A-9002829 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA