
CAS Number2051-18-5
Synonyms1-(Chloromethyl)-4-isopropylbenzene; 7-Chloro-p-cymene; para-isopropylbenzyl chloride; 4-i-propylbenzyl chloride; p-Cymene,7-chloro; 4-isopropyl-1-chloromethylbenzene; MFCD00018885; EINECS 218-114-6; 4-Isopropylbenzyl chloride; p-Isopropyl benzyl chloride; p-Isopropylbenzyl chloride
Molecular FormulaC10H13Cl
Molecular Weight168.663
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point228.2±9.0 °C at 760 mmHg
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2051-18-5 |
| Catalog No. | 2A-9027905 |
| Chinese Name | 4-异丙基苄氯 |
| Synonyms | 1-(Chloromethyl)-4-isopropylbenzene; 7-Chloro-p-cymene; para-isopropylbenzyl chloride; 4-i-propylbenzyl chloride; p-Cymene,7-chloro; 4-isopropyl-1-chloromethylbenzene; MFCD00018885; EINECS 218-114-6; 4-Isopropylbenzyl chloride; p-Isopropyl benzyl chloride; p-Isopropylbenzyl chloride |
| Molecular Formula | C10H13Cl |
| Molecular Weight | 168.663 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 228.2±9.0 °C at 760 mmHg |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | II |
| HTC | 2903999090 |
| PubChem ID | 91828 |
| SMILES | CC(C)c1ccc(CCl)cc1 |
| InChI | InChI=1S/C10H13Cl/c1-8(2)10-5-3-9(7-11)4-6-10/h3-6,8H,7H2,1-2H3 |
| InChI Key | CYAKWEQUWJAHLW-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Dibutyl oxalate | 2050-60-4 | 2A-9027900 |
| Bis(2-methylpropyl) oxalate | 2050-61-5 | 2A-9027901 |
| 2,2'-Dinitro-4,4'-dichlorodiphenyl disufide | 2050-66-0 | 2A-9027902 |
| Diallyl trisulfide | 2050-87-5 | 2A-9027903 |
| Diamylamine | 2050-92-2 | 2A-9027904 |
| 4-Chlorobiphenyl | 2051-62-9 | 2A-9027908 |
| Acrylic anhydride | 2051-76-5 | 2A-9027909 |
| alpha,alpha-Dichlorodiphenylmethane | 2051-90-3 | 2A-9027911 |
| 3-Benzoylpropionic acid | 2051-95-8 | 2A-9027912 |
| Benzyl lactate | 2051-96-9 | 2A-9027913 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA