
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 60468-36-2 |
| Catalog No. | 2A-9002789 |
| Chinese Name | 2-氯-2',5'-二氟苯乙酮 |
| Synonyms | 2-Chloro-1-(2,5-difluorophenyl)ethanone; MFCD04115827 |
| Molecular Formula | C8H5O1Cl1F2 |
| Molecular Weight | 190.58 |
| Purity | 98 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 240.5±25.0 °C at 760 mmHg |
| Melting Point | 56-58 °C(lit.) |
| Appearance | white solid |
| Storage Condition | Store in a sealed container in a cool, dry place w |
| HTC | 2914700090 |
| MDL Number | MFCD04115827 |
| SMILES | O=C(CCl)c1cc(F)ccc1F |
| InChI | InChI=1S/C8H5ClF2O/c9-4-8(12)6-3-5(10)1-2-7(6)11/h1-3H,4H2 |
| InChI Key | HJWDDTDVBUFTCP-UHFFFAOYSA-N |
| MSDS | msds/2789_1_60468_36_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Chloro-1,4-naphthalenedione | 1010-60-2 | 2A-9002782 |
| 2-Chloro-10,11-dihydro-11-oxo-dibenzo[b,f][1,4]oxazepine | 3158-91-6 | 2A-9002783 |
| 2-Chloro-1-methyl-2-phenylacetate | 7476-66-6 | 2A-9002786 |
| 2-Chloro-2-(2'-chlorophenyl)acetic acid methyl ester | 90055-47-3 | 2A-9002787 |
| 2-Chloro-2,2-difluoroacetophenone | 384-67-8 | 2A-9002788 |
| 2-Chloro-2-nitroacetanilide | 10147-70-3 | 2A-9002792 |
| 2-Chloro-3,3,3-trifluoroprop-1-ene | 2730-62-3 | 2A-9002798 |
| 2-Chloro-3,4-difluoronitrobenzene | 169468-83-1 | 2A-9002799 |
| 2-Chloro-3,5-difluoroaniline | 36556-60-2 | 2A-9002801 |
| 2-Chloro-3,5-dinitrobenzotrifluoride | 392-95-0 | 2A-9002803 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA