CAS Number2010-06-2
SynonymsMFCD00039680; 2-Thiazolamine,4-phenyl; 4-phenyl-2-aminothiazole; 2-Amino-4-phenyl-1,3-thiazole; 4-Phenyl-1,3-thiazol-2-amine; 2-amino-4-phenylthiazol; 4-Phenyl-2-thiazolylamine; Phenthiazamine; 4-Phenylthiazol-2-amine; 2-Amino-4-phenylthiazole; 4-Phenyl-2-thiazolamine; 4-phenyl-1,3-thiazole-2-amine; EINECS 217-926-8; 4-Phenyl-thiazol-2-ylamine; Thiazole,2-amino-4-phenyl; T5N CSJ BZ ER; 4-phenyl-1,3-thiazol-2-ylamine
Molecular FormulaC9H8N2S
Molecular Weight201.25
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point363.4±11.0 °C at 760 mmHg
Melting Point149-153 °C(lit.)
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2010-06-2 |
| Catalog No. | 2A-9027804 |
| Chinese Name | 2-氨基-4-苯基噻唑 |
| Synonyms | MFCD00039680; 2-Thiazolamine,4-phenyl; 4-phenyl-2-aminothiazole; 2-Amino-4-phenyl-1,3-thiazole; 4-Phenyl-1,3-thiazol-2-amine; 2-amino-4-phenylthiazol; 4-Phenyl-2-thiazolylamine; Phenthiazamine; 4-Phenylthiazol-2-amine; 2-Amino-4-phenylthiazole; 4-Phenyl-2-thiazolamine; 4-phenyl-1,3-thiazole-2-amine; EINECS 217-926-8; 4-Phenyl-thiazol-2-ylamine; Thiazole,2-amino-4-phenyl; T5N CSJ BZ ER; 4-phenyl-1,3-thiazol-2-ylamine |
| Molecular Formula | C9H8N2S |
| Molecular Weight | 201.25 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 363.4±11.0 °C at 760 mmHg |
| Melting Point | 149-153 °C(lit.) |
| Appearance | solid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2934100090 |
| PubChem ID | 329774679 |
| MDL Number | MFCD22683032 |
| SMILES | NC1=NC(C2=CC=CC=C2)=C(C#N)S1 |
| InChI | 1S/C10H7N3S/c11-6-8-9(13-10(12)14-8)7-4-2-1-3-5-7/h1-5H,(H2,12,13) |
| InChI Key | JHEXUURKXQZMDP-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 5-Bromo-2-methyl-1H-benzo[d]imidazole | 1964-77-8 | 2A-9027739 |
| 6-Methylpurine | 14675-48-0 | 2A-9027793 |
| 2-Bromoquinoline | 2005-43-8 | 2A-9027796 |
| 2-Trifluoromethylbenzoxazole | 2008-04-0 | 2A-9027797 |
| 2,2'-(1,4-Butanediyl)bis-1,3-benzoxazole | 2008-10-8 | 2A-9027798 |
| 2,6-Dibromopyridine-4-carboxylic acid | 2016-99-1 | 2A-9027816 |
| 6-oxo-1,6-dihydropyridazine-4-carboxylicacid | 867130-58-3 | 2A-9027823 |
| 2-(1-Methyl-2-oxopropyl)-1H-isoindole-1,3-(2H)-dione | 2028-33-3 | 2A-9027829 |
| 1-(3-Chloropropyl)-4-methylpiperazine dihydrochloride | 2031-23-4 | 2A-9027833 |
| 4-(2-Aminoethyl)morpholine | 2038-03-1 | 2A-9027852 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS