CAS Number2008-58-4
Synonyms2.6-Dichlor-benzamid; dichlobenil; 2,6-BAM; Benzamide,2,6-dichloro; Benzamide,6-dichloro; 2,6-Dichlorobenzamide; BAM; 2,6-dichloro-benzamide; MFCD00007975; 2,6-dichloro-benzoic acid amide; EINECS 217-918-4; 2,6-Dichlor-benzoesaeure-amid
Molecular FormulaC22H14O1N4Cl2
Molecular Weight421.28
Purity98.00%
Density1.5±0.1 g/cm3
Boiling Point300.7±52.0 °C at 760 mmHg
Melting Point196-199 °C(lit.)
Appearancelight gray powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2008-58-4 |
| Catalog No. | 2A-9027801 |
| Chinese Name | 2,6-二氯苯甲酰胺 |
| Synonyms | 2.6-Dichlor-benzamid; dichlobenil; 2,6-BAM; Benzamide,2,6-dichloro; Benzamide,6-dichloro; 2,6-Dichlorobenzamide; BAM; 2,6-dichloro-benzamide; MFCD00007975; 2,6-dichloro-benzoic acid amide; EINECS 217-918-4; 2,6-Dichlor-benzoesaeure-amid |
| Molecular Formula | C22H14O1N4Cl2 |
| Molecular Weight | 421.28 |
| Purity | 98.00 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 300.7±52.0 °C at 760 mmHg |
| Melting Point | 196-199 °C(lit.) |
| Appearance | light gray powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2924299090 |
| PubChem ID | 13117 |
| MDL Number | MFCD32067977 |
| SMILES | NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C7H5Cl2NO/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H2,10,11) |
| InChI Key | JHSPCUHPSIUQRB-UHFFFAOYSA-N |
| MSDS | msds/27801_1_2008_58_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 95.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(2-Nitrophenyl)propanoic acid | 2001-32-3 | 2A-9027785 |
| Tetraphenylphosphonium chloride | 2001-45-8 | 2A-9027786 |
| (4aR,8aR)-rel-1,2,3,4,4a,5,8,8a-Octahydronaphthalene | 2001-50-5 | 2A-9027787 |
| Dipotassium EDTA | 2001-94-7 | 2A-9027788 |
| Flumethasone 21-pivalate | 2002-29-1 | 2A-9027790 |
| 2,6-Dichlorobenzyl chloride | 2014-83-7 | 2A-9027808 |
| N-[4-(Aminosulfonyl)benzyl]acetamide | 2015-14-7 | 2A-9027809 |
| 5-Amino-2-chlorobenzenesulfonamide | 2015-19-2 | 2A-9027810 |
| Choline salicylate | 2016-36-6 | 2A-9027811 |
| 1-Tetradecylamine | 2016-42-4 | 2A-9027812 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS