
CAS Number1940-18-7
Synonyms1-ethyl-1-cyclophexanol; MFCD00021402; 1-ethyl-1-cyclohexanol; ethylcyclohexanol; 1-Ethylcyclohexanol; 1-hydroxy-1-ethylcyclohexane; 1-Aethyl-cyclohexanol-(1) [German]; 1-n-ethylcyclohexanol; ethylcyclohexyl alcohol; Cyclohexanol,1-ethyl
Molecular FormulaC8H16O
Molecular Weight128.21
Purity98.00%
Density0.9±0.1 g/cm3
Boiling Point166.0±0.0 °C at 760 mmHg
Melting Point34.5ºC
AppearanceColorless - light yellow transparent liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1940-18-7 |
| Catalog No. | 2A-9027707 |
| Chinese Name | 1-乙基环己醇 |
| Synonyms | 1-ethyl-1-cyclophexanol; MFCD00021402; 1-ethyl-1-cyclohexanol; ethylcyclohexanol; 1-Ethylcyclohexanol; 1-hydroxy-1-ethylcyclohexane; 1-Aethyl-cyclohexanol-(1) [German]; 1-n-ethylcyclohexanol; ethylcyclohexyl alcohol; Cyclohexanol,1-ethyl |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.21 |
| Purity | 98.00 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 166.0±0.0 °C at 760 mmHg |
| Melting Point | 34.5ºC |
| Appearance | Colorless - light yellow transparent liquid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2906199090 |
| PubChem ID | 86701 |
| SMILES | CCC1(O)CCCCC1 |
| InChI | InChI=1S/C8H16O/c1-2-8(9)6-4-3-5-7-8/h9H,2-7H2,1H3 |
| InChI Key | BUCJHJXFXUZJHL-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2906199090. cyclanic, cyclenic or cyclootherpenic alcohols. VAT:17.0%. Tax rebate rate:13.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Methoxycinnamic acid ethyl ester | 1929-30-2 | 2A-9027695 |
| Mordant Red 19 | 1934-24-3 | 2A-9027700 |
| Sodium dicyanamide | 1934-75-4 | 2A-9027701 |
| Direct Black 38 | 1937-37-7 | 2A-9027703 |
| 1,3-Propylenediaminetertaacetic acid | 1939-36-2 | 2A-9027705 |
| 4-Bromo-2,5-dichlorophenol | 1940-42-7 | 2A-9027708 |
| Tetramethylammonium nitrate | 1941-24-8 | 2A-9027710 |
| Tetraethylammonium nitrate | 1941-26-0 | 2A-9027711 |
| Tetrabutylammonium nitrate | 1941-27-1 | 2A-9027712 |
| Tetrapropylammonium bromide | 1941-30-6 | 2A-9027713 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA