
CAS Number1888-33-1
SynonymsN-ethanoyl-4-methyl-benzenesulfonamide; N-Acetyl-p-toluene sulfonamide; N-p-tolylsulfonylacetamide; N-acetyl-4-toluenesulfonamide; T0400-0172
Molecular FormulaC9H11NO3S
Molecular Weight213.25400
Purity98.00%
Density1.254 g/cm3
Melting Point140 °C
AppearanceSolid;White to Almost white powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1888-33-1 |
| Catalog No. | 2A-9027642 |
| Chinese Name | N-乙酰基对甲苯磺酰胺 |
| Synonyms | N-ethanoyl-4-methyl-benzenesulfonamide; N-Acetyl-p-toluene sulfonamide; N-p-tolylsulfonylacetamide; N-acetyl-4-toluenesulfonamide; T0400-0172 |
| Molecular Formula | C9H11NO3S |
| Molecular Weight | 213.25400 |
| Purity | 98.00 |
| Density | 1.254 g/cm3 |
| Melting Point | 140 °C |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | room temperature, dry |
| HTC | 2935009090 |
| PubChem ID | 428440 |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C9H11NO3S/c1-7-3-5-9(6-4-7)14(12,13)10-8(2)11/h3-6H,1-2H3,(H,10,11) |
| InChI Key | BVJCFOOIOSGZFW-UHFFFAOYSA-N |
| MSDS | msds/27642_1_1888_33_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 35.0% |
| Transport Info | Product name: Summary 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6-Hydroxy-2-methylquinazolin-4(3H)-one | 1882-77-5 | 2A-9027631 |
| Furfuryl isopropyl sulfide | 1883-78-9 | 2A-9027634 |
| 4-Methoxyphthalic acid | 1885-13-8 | 2A-9027636 |
| Phenyl chloroformate | 1885-14-9 | 2A-9027637 |
| 3,4,5-Trimethoxybenzonitrile | 1885-35-4 | 2A-9027639 |
| Ethyl vinyl sulfone | 1889-59-4 | 2A-9027644 |
| 2,3-Dimethyl-2,3-diphenylbutane | 1889-67-4 | 2A-9027645 |
| 4'-Chloro-2-phenylacetophenone | 1889-71-0 | 2A-9027646 |
| Chloroxynil | 1891-95-8 | 2A-9027648 |
| 3-Phenanthrylamine | 1892-54-2 | 2A-9027649 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA