
CAS Number1860-58-8
Synonyms3-Benzyloxyphenylacetic acid; MFCD02664806; 2-(3-(Benzyloxy)phenyl)acetic acid
Molecular FormulaC15H14O3
Molecular Weight242.27000
Purity98.00%
Density1.201g/cm3
Boiling Point418.4ºC at 760 mmHg
Melting Point121-125ºC
AppearanceWhite-off-white crystal-powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1860-58-8 |
| Catalog No. | 2A-9027588 |
| Chinese Name | 3-苄氧基苯乙酸 |
| Synonyms | 3-Benzyloxyphenylacetic acid; MFCD02664806; 2-(3-(Benzyloxy)phenyl)acetic acid |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27000 |
| Purity | 98.00 |
| Density | 1.201g/cm3 |
| Boiling Point | 418.4ºC at 760 mmHg |
| Melting Point | 121-125ºC |
| Appearance | White-off-white crystal-powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2918990090 |
| PubChem ID | 6765777 |
| SMILES | O=C(O)Cc1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C15H14O3/c16-15(17)10-13-7-4-8-14(9-13)18-11-12-5-2-1-3-6-12/h1-9H,10-11H2,(H,16,17) |
| InChI Key | LLZKAZNUCYYBQO-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-(Butoxymethyl)acrylamide | 1852-16-0 | 2A-9027580 |
| Propyleneurea | 1852-17-1 | 2A-9027581 |
| 1,3-Dihydroxymethyl-4,5-dihydroxyimidazol-2-one | 1854-26-8 | 2A-9027584 |
| 2-Amino-N,N-dimethylacetamide | 1857-19-8 | 2A-9027586 |
| Hexahydro-1-methyl-4H-azepin-4-one | 1859-33-2 | 2A-9027587 |
| Ammonium benzoate | 1863-63-4 | 2A-9027592 |
| 4-Nitrophenyl formate | 1865-01-6 | 2A-9027593 |
| Dibromofluoromethane | 1868-53-7 | 2A-9027598 |
| Difluorosulfoacetic acid dimethyl ester | 1869-42-7 | 2A-9027601 |
| Tetrazolium Blue Chloride | 1871-22-3 | 2A-9027603 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA