![1-[4-(Benzyloxy)-3-methoxyphenyl]ethanone structure, CAS 1835-11-6](/structures/40000/27548_2_1835_11_6.png)
CAS Number1835-11-6
Synonymsacetovanillone; O-benzyl acetovanillone; 1-(4-Benzyloxy-3-methoxyphenyl)ethanone; 1-(4-BENZYLOXY-3-METHOXY-PHENYL)-ETHANONE; MFCD00017326; 1-[4-(Benzyloxy)-3-methoxyphenyl]ethanone
Molecular FormulaC16H16O3
Molecular Weight256.3
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point396.5±27.0 °C at 760 mmHg
Melting Point85-87ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1835-11-6 |
| Catalog No. | 2A-9027548 |
| Chinese Name | 4-苄氧基-3-甲氧基苯乙酮 |
| Synonyms | acetovanillone; O-benzyl acetovanillone; 1-(4-Benzyloxy-3-methoxyphenyl)ethanone; 1-(4-BENZYLOXY-3-METHOXY-PHENYL)-ETHANONE; MFCD00017326; 1-[4-(Benzyloxy)-3-methoxyphenyl]ethanone |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.3 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 396.5±27.0 °C at 760 mmHg |
| Melting Point | 85-87ºC |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2914509090 |
| PubChem ID | 450532 |
| SMILES | COc1cc(C(C)=O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C16H16O3/c1-12(17)14-8-9-15(16(10-14)18-2)19-11-13-6-4-3-5-7-13/h3-10H,11H2,1-2H3 |
| InChI Key | HRUAWSQBQLYDKH-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Trimethylmethoxysilane | 1825-61-2 | 2A-9027533 |
| Ethoxytrimethylsilane | 1825-62-3 | 2A-9027534 |
| Trimethyl(propoxy)silane | 1825-63-4 | 2A-9027535 |
| 3-Chlorosalicylic acid | 1829-32-9 | 2A-0201379 |
| Benzylchlorodimethylsilane | 1833-31-4 | 2A-9027546 |
| 3,4,5,6-Tetrafluorophthalonitrile | 1835-65-0 | 2A-9027551 |
| Benzyltriethylammonium hydroxide | 1836-42-6 | 2A-9027552 |
| 1-(4-Chlorophenoxy)-4-nitrobenzene | 1836-74-4 | 2A-9027554 |
| Octabenzone | 1843-05-6 | 2A-9027561 |
| 4,4'-Dihydroxytetraphenylmethane | 1844-01-5 | 2A-9027562 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA