
CAS Number1795-05-7
Synonyms2,4,5-trimethylthiophene; 2,3,5-Trimethylthiophene; Trimethylthiophene; 2,3,5-Trimethyl-thiophen; 2,3,4,6-TETRAFLUOROBENZENEBORONIC ACID; 2,3,4-Trimethylthiophen; 2,3,4-Trimethylthiophene; 2,3,5-trimethyl-thiophene; MFCD00142784; Trimethylthiophen; EINECS 217-269-7
Molecular FormulaC7H10S
Molecular Weight126.219
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point166.6±9.0 °C at 760 mmHg
AppearanceLiquid;Colorless to Almost colorless clear liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1795-05-7 |
| Catalog No. | 2A-9027486 |
| Chinese Name | 2,3,5-三甲基噻吩 |
| Synonyms | 2,4,5-trimethylthiophene; 2,3,5-Trimethylthiophene; Trimethylthiophene; 2,3,5-Trimethyl-thiophen; 2,3,4,6-TETRAFLUOROBENZENEBORONIC ACID; 2,3,4-Trimethylthiophen; 2,3,4-Trimethylthiophene; 2,3,5-trimethyl-thiophene; MFCD00142784; Trimethylthiophen; EINECS 217-269-7 |
| Molecular Formula | C7H10S |
| Molecular Weight | 126.219 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 166.6±9.0 °C at 760 mmHg |
| Appearance | Liquid;Colorless to Almost colorless clear liquid |
| Storage Condition | Store under inert gas; avoid air |
| PubChem ID | 3188868 |
| SMILES | Cc1cc(C)c(C)s1 |
| InChI | InChI=1S/C7H10S/c1-5-4-6(2)8-7(5)3/h4H,1-3H3 |
| InChI Key | QKZJQIHBRCFDGQ-UHFFFAOYSA-N |
| Transport Info | Product Name: 2,3,5-Trimethylthiophene |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4,4'-Bis(ethoxycarbonly)-2,2'-bipyridine | 1762-42-1 | 2A-9027437 |
| 2-(Hydroxymethyl)quinoline | 1780-17-2 | 2A-9027465 |
| 4,5,6-Trichloropyrimidine | 1780-27-4 | 2A-9027468 |
| 4,6-Dichloro-2,5-dimethylpyrimidine | 1780-33-2 | 2A-9027470 |
| 3-Ethylthiophene | 1795-01-3 | 2A-9027485 |
| 2,2'-Bipyridine-5,5'-dicarboxylic acid | 1802-30-8 | 2A-9027497 |
| 2-tert-Butyl-1H-indole | 1805-65-8 | 2A-9027501 |
| 6-Bromo-2-chloroquinoline | 1810-71-5 | 2A-9027508 |
| 2,6-Dichloroquinoline | 1810-72-6 | 2A-9027509 |
| 5-(Chloromethyl)-3-phenyl-1,2,4-oxadiazole | 1822-94-2 | 2A-9027526 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA