
CAS Number1789-58-8
SynonymsEINECS 217-255-0; Silane,dichloroethyl; MONOETHYLDICHLOROSILANE; Ethyldichlorosilane; Dichloro(ethyl)silane; UN1183; dichloro-ethyl-silane; Ethyl dichlorosilane; MFCD00053205
Molecular FormulaC2H6Cl2Si
Molecular Weight129.061
Purity98.00%
Density1.089 g/mL at 20 °C(lit.)
Boiling Point69.8±9.0 °C at 760 mmHg
Melting Point-107°C
AppearanceA colorless, smoking liquid with a spicy odor
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1789-58-8 |
| Catalog No. | 2A-0201443 |
| Chinese Name | 乙基二氯硅烷 |
| Synonyms | EINECS 217-255-0; Silane,dichloroethyl; MONOETHYLDICHLOROSILANE; Ethyldichlorosilane; Dichloro(ethyl)silane; UN1183; dichloro-ethyl-silane; Ethyl dichlorosilane; MFCD00053205 |
| Molecular Formula | C2H6Cl2Si |
| Molecular Weight | 129.061 |
| Purity | 98.00 |
| Density | 1.089 g/mL at 20 °C(lit.) |
| Boiling Point | 69.8±9.0 °C at 760 mmHg |
| Melting Point | -107°C |
| Appearance | A colorless, smoking liquid with a spicy odor |
| Storage Condition | Storage precautions: Store in a cool, dry, well-ve |
| Packaging | I |
| HTC | 2931900090 |
| PubChem ID | 7345623 |
| SMILES | CC[Si](Cl)Cl |
| InChI | InChI=1S/C2H5Cl2Si/c1-2-5(3)4/h2H2,1H3 |
| InChI Key | PFMKUUJQLUQKHT-UHFFFAOYSA-N |
| Hazard Symbols | 4.3 |
| Tax Rebate | 13.0% |
| Supervision | AB (Inbound cargo customs clearance form) |
| Transport Info | Product name: Chemical name |
| Related Products in Semiconductor Chemical Intermediates | ||
|---|---|---|
| Sodium bis(trimethylsilyl)amide | 1070-89-9 | 2A-9026014 |
| Molybdenum disulfide | 1309-56-4 | 2A-9026609 |
| Molybdenum disulfide | 1317-33-5 | 2A-9026650 |
| (Chloromethyl)trichlorosilane | 1558-25-4 | 2A-9027028 |
| Dimethylvinylchlorosilane | 1719-58-0 | 2A-9027352 |
| (Trimethylsilyl)methyllithium | 1822-00-0 | 2A-9027522 |
| 2-(Trimethylsilyloxy)propene | 1833-53-0 | 2A-9027547 |
| 3-(Trimethylsilyl)-1-propanesulfonic acid sodium salt | 2039-96-5 | 2A-9027863 |
| N,N-Dimethyltrimethylsilylamine | 2083-91-2 | 2A-9027956 |
| Bis(trimethylsilyl)methane | 2117-28-4 | 2A-9028009 |
| Browse all Semiconductor Chemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA