
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1737-19-5 |
| Catalog No. | 2A-9027391 |
| Chinese Name | 3-氟苯基丙酮 |
| Synonyms | 1-(3-Fluorophenyl)propan-2-one; MFCD00061144 |
| Molecular Formula | C9H9O1F1 |
| Molecular Weight | 152.17 |
| Purity | 98.00 |
| Density | 1.086 g/cm3 |
| Boiling Point | 199.3ºC at 760 mmHg |
| Appearance | Transparent yellow-green liquid |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| HTC | 2914700090 |
| PubChem ID | 3154518 |
| MDL Number | MFCD00061144 |
| SMILES | CC(=O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C9H9FO/c1-7(11)5-8-3-2-4-9(10)6-8/h2-4,6H,5H2,1H3 |
| InChI Key | UWCPYXSRCQVABG-UHFFFAOYSA-N |
| MSDS | msds/27391_1_1737_19_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Industrial Applications | ||
|---|---|---|
| 2-Nitro-4-methylsulfonyltoluene | 1671-49-4 | 2A-9027245 |
| 3-Cyclohexene-1-methanol | 1679-51-2 | 2A-9027267 |
| 2-[2-(Dimethylamino)ethoxy]ethanol | 1704-62-7 | 2A-9027320 |
| 3-(1,1,2,2-Tetrafluoroethoxy)toluene | 1737-10-6 | 2A-9027389 |
| 4-(1,1,2,2-Tetrafluoroethoxy)toluene | 1737-11-7 | 2A-9027390 |
| 3-Phenyl-L-alanine benzyl ester 4-toluenesulphonate | 1738-78-9 | 2A-9027397 |
| Acetone thiosemicarbazone | 1752-30-3 | 2A-9027416 |
| cis-1,2-Cyclohexanediol diacetate | 1759-71-3 | 2A-9027430 |
| 5-(4-Methoxyphenyl)cyclohexane-1,3-dione | 1774-12-5 | 2A-9027448 |
| cis-1,2-Cyclohexanediol | 1792-81-0 | 2A-9027484 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA