
CAS Number1721-93-3
SynonymsMFCD00006902; EINECS 217-017-6; 1-Methylisoquinoline
Molecular FormulaC10H8ClN
Molecular Weight177.635
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point248.0±0.0 °C at 760 mmHg
Melting Point10-12°C
AppearanceWhite to light yellow liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1721-93-3 |
| Catalog No. | 2A-9027359 |
| Chinese Name | 1-甲基异喹啉 |
| Synonyms | MFCD00006902; EINECS 217-017-6; 1-Methylisoquinoline |
| Molecular Formula | C10H8ClN |
| Molecular Weight | 177.635 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 248.0±0.0 °C at 760 mmHg |
| Melting Point | 10-12°C |
| Appearance | White to light yellow liquid |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| Packaging | Ⅲ |
| HTC | 2933499090 |
| PubChem ID | 404241 |
| MDL Number | MFCD09907915 |
| SMILES | Cc1nccc2ccccc12 |
| InChI | InChI=1S/C10H9N/c1-8-10-5-3-2-4-9(10)6-7-11-8/h2-7H,1H3 |
| InChI Key | PBYMYAJONQZORL-UHFFFAOYSA-N |
| Hazard Symbols | Category 6.1 Poisons |
| MSDS | msds/27359_1_1721_93_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Chemical name |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 6-Bromo-4-chloro-2-(trifluoromethyl)quinoline | 1701-28-6 | 2A-9027314 |
| Ethyl 2-methyl-6-phenylpyridine-3-carboxylate | 1702-14-3 | 2A-9027317 |
| 2,5-Dihydrofuran | 1708-29-8 | 2A-9027328 |
| 3-Acetyl-2-methylpyridine | 1721-12-6 | 2A-9027355 |
| 3-Cyano-2-methylpyridine | 1721-23-9 | 2A-9027357 |
| 1-(6-Chloro-pyridazino-3-yl)piperidine | 1722-11-8 | 2A-9027360 |
| Phenyl-1,3,5-triazine | 1722-18-5 | 2A-9027362 |
| 8-Methoxyisoquinoline | 1723-70-2 | 2A-9027365 |
| 2,3,5,6-Tetrafluoro-4-hydrazinopyridine | 1735-44-0 | 2A-9027380 |
| 1,2-Dimethylimidazole | 1739-84-0 | 2A-9027398 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA