CAS Number1698-60-8
Synonyms5-Amino-4-chlor-2-phenylpyridazin-3(2H)-on; Chloridazon; pyrazon; MFCD00055402; PYRAMIN; 5-amino-4-chloro-2-phenylpyridazin-3(2H)-one; 5-Amino-4-chloro-2-phenyl-2H-pyridazin-3-one; PAC; EINECS 216-920-2; 5-Amino-4-chloro-2-phenyl-3(2H)-pyridazinone; Chloridazon,Pyrazone; Poly (acrylic acid-co-hypophosphite) sodium salt
Molecular FormulaC10H8ClN3O
Molecular Weight221.64
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point312.2±52.0 °C at 760 mmHg
Melting Point206ºC (tech., 198-202ºC)
AppearanceColorless, odorless solid, (n-butyl stearate, brown, almost odorless solid)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1698-60-8 |
| Catalog No. | 2A-9027304 |
| Chinese Name | 5-氨基-4-氯-2-苯基-3(2H)-哒嗪酮 |
| Synonyms | 5-Amino-4-chlor-2-phenylpyridazin-3(2H)-on; Chloridazon; pyrazon; MFCD00055402; PYRAMIN; 5-amino-4-chloro-2-phenylpyridazin-3(2H)-one; 5-Amino-4-chloro-2-phenyl-2H-pyridazin-3-one; PAC; EINECS 216-920-2; 5-Amino-4-chloro-2-phenyl-3(2H)-pyridazinone; Chloridazon,Pyrazone; Poly (acrylic acid-co-hypophosphite) sodium salt |
| Molecular Formula | C10H8ClN3O |
| Molecular Weight | 221.64 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 312.2±52.0 °C at 760 mmHg |
| Melting Point | 206ºC (tech., 198-202ºC) |
| Appearance | Colorless, odorless solid, (n-butyl stearate, brown, almost odorless solid) |
| Water Solubility | Water solubility: insoluble; water solubility: 400 |
| Storage Condition | Sealed storage at 0-6°C |
| HTC | 2933990017 |
| PubChem ID | 3329473 |
| MDL Number | MFCD00055402 |
| SMILES | NC1=C(Cl)C(=O)N(N=C1)c2ccccc2 |
| InChI | 1S/C10H8ClN3O/c11-9-8(12)6-13-14(10(9)15)7-4-2-1-3-5-7/h1-6H,12H2 |
| InChI Key | WYKYKTKDBLFHCY-UHFFFAOYSA-N |
| Beilstein/REAXYS | 397241 |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/27304_1_1698_60_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | S. Import and export pesticide registration certificate |
| Transport Info | Product name: Supervision conditions S. Import and export pesticide registration certificate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Bromoxynil octanoate | 1689-99-2 | 2A-9027289 |
| N-Ethyl-N-(2-hydroxyethyl)perfluorooctylsulphonamide | 1691-99-2 | 2A-9027292 |
| 1,1,3,3-Tetramethyltetraphenylcyclotetrasiloxane | 1693-47-6 | 2A-9027296 |
| Acid Violet 49 | 1694-09-3 | 2A-9027299 |
| tert-Butyl acetoacetate | 1694-31-1 | 2A-9027300 |
| 3,4-Dibenzyloxyphenethylamine hydrochloride | 1699-56-5 | 2A-9027305 |
| 3-Benzyloxybenzyl bromide | 1700-31-8 | 2A-9027307 |
| Methoxyphenylacetic acid | 1701-77-5 | 2A-9027316 |
| 4-Imidazolidinone | 1704-79-6 | 2A-9027321 |
| 6-Methylchrysene | 1705-85-7 | 2A-9027322 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS