CAS Number1689-84-5
SynonymsBromoxynil; 3,5-Dibromo-4-hydroxybenzonitrile; EINECS 216-882-7; Merit; torch; 4-10-00-00475 (Beilstein Handbook Reference); Bronate; Chipro buctril; 3,5-Dibromo-4-hydroxyphenyl cyanide; Brominal; MFCD00002153; M&B 10,064; Sabre; QR BE FE DCN; Buctril M; Certrol B
Molecular FormulaBr2C6H2(OH)CN
Molecular Weight276.91
Purity98.00%
Density2.2±0.1 g/cm3
Boiling Point265.6±40.0 °C at 760 mmHg
Melting Point189-191 °C(lit.)
AppearanceOff-white to light orange crystalline powder
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1689-84-5 |
| Catalog No. | 2A-9027287 |
| Chinese Name | 溴苯腈 |
| Synonyms | Bromoxynil; 3,5-Dibromo-4-hydroxybenzonitrile; EINECS 216-882-7; Merit; torch; 4-10-00-00475 (Beilstein Handbook Reference); Bronate; Chipro buctril; 3,5-Dibromo-4-hydroxyphenyl cyanide; Brominal; MFCD00002153; M&B 10,064; Sabre; QR BE FE DCN; Buctril M; Certrol B |
| Molecular Formula | Br2C6H2(OH)CN |
| Molecular Weight | 276.91 |
| Purity | 98.00 |
| Density | 2.2±0.1 g/cm3 |
| Boiling Point | 265.6±40.0 °C at 760 mmHg |
| Melting Point | 189-191 °C(lit.) |
| Appearance | Off-white to light orange crystalline powder |
| Water Solubility | 0.13 G/L (25 ºC) |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| Packaging | III |
| HTC | 2926909032 |
| PubChem ID | 6856 |
| SMILES | N#Cc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C7H3Br2NO/c8-5-1-4(3-10)2-6(9)7(5)11/h1-2,11H |
| InChI Key | UPMXNNIRAGDFEH-UHFFFAOYSA-N |
| Hazard Symbols | 6.1(b) |
| Tax Rebate | 9.0% |
| Supervision | S. Import and export pesticide registration certificate |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Vanadium(V) oxytriethoxide | 1686-22-2 | 2A-9027280 |
| 2-Quinazolinamine | 1687-51-0 | 2A-9027282 |
| 5-Amino-2-methoxyphenol | 1687-53-2 | 2A-9027283 |
| 9-Hydroxyfluorene | 1689-64-1 | 2A-9027284 |
| Ioxynil | 1689-83-4 | 2A-9027286 |
| Bromoxynil octanoate | 1689-99-2 | 2A-9027289 |
| N-Ethyl-N-(2-hydroxyethyl)perfluorooctylsulphonamide | 1691-99-2 | 2A-9027292 |
| 1,1,3,3-Tetramethyltetraphenylcyclotetrasiloxane | 1693-47-6 | 2A-9027296 |
| Acid Violet 49 | 1694-09-3 | 2A-9027299 |
| tert-Butyl acetoacetate | 1694-31-1 | 2A-9027300 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS