CAS Number1681-36-3
SynonymsT6NJ C1 DG; 4-Chloro-3-methylpyridine; 4-Chlor-3-methyl-pyridin; MFCD03092890; 3-methyl-4-chloropyridine; 4-chloro-3-methyl pyridine; 4-Chloro-3-picoline; 4-chloropicolyl chloride hydrochloride
Molecular FormulaC6H7Cl2N
Molecular Weight164.035
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point176.2±20.0 °C at 760 mmHg
Melting Point165-169 °C(lit.)
AppearanceLight yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1681-36-3 |
| Catalog No. | 2A-9027273 |
| Chinese Name | 4-氯-3-甲基吡啶 |
| Synonyms | T6NJ C1 DG; 4-Chloro-3-methylpyridine; 4-Chlor-3-methyl-pyridin; MFCD03092890; 3-methyl-4-chloropyridine; 4-chloro-3-methyl pyridine; 4-Chloro-3-picoline; 4-chloropicolyl chloride hydrochloride |
| Molecular Formula | C6H7Cl2N |
| Molecular Weight | 164.035 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 176.2±20.0 °C at 760 mmHg |
| Melting Point | 165-169 °C(lit.) |
| Appearance | Light yellow liquid |
| Storage Condition | Store at room temperature in a cool and ventilated |
| HTC | 2933399090 |
| PubChem ID | 3184470 |
| MDL Number | MFCD09865465 |
| SMILES | Cc1cnccc1Cl |
| InChI | InChI=1S/C6H6ClN/c1-5-4-8-3-2-6(5)7/h2-4H,1H3 |
| InChI Key | DZNXMHJMXLSNIR-UHFFFAOYSA-N |
| MSDS | msds/27273_1_1681_36_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 3-Bromo-4-nitropyridine 1-oxide | 1678-49-5 | 2A-9027261 |
| Diethyl 3,4-pyridinedicarboxylate | 1678-52-0 | 2A-9027262 |
| 3-Methyl-4-nitropyridine | 1678-53-1 | 2A-9027263 |
| 4-Phenyl-1H-1,2,3-triazole | 1680-44-0 | 2A-9027271 |
| 2-Chloropurine | 1681-15-8 | 2A-9027272 |
| 4-Chloro-5-fluoro-2-pyrimidinamine | 1683-75-6 | 2A-9027277 |
| 2-tert-Butylthiophene | 1689-78-7 | 2A-9027285 |
| Methyl 1-methylpiperidine-3-carboxylate | 1690-72-8 | 2A-9027290 |
| Methyl N-methyl-4-piperidinecarboxylate | 1690-75-1 | 2A-9027291 |
| 3-Hexylthiophene | 1693-86-3 | 2A-9027297 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS