
CAS Number1623-14-9
Synonymsmonoethyl phosphate; ethyl phosphoric acid; Ethyl phosphate,mono; EINECS 216-603-9; Monoethyl acid phosphate; Phosphorsaeure-monoaethylester; Ethyl dihydrogen phosphate; phosphoric acid triethylester; PHOSPHORIC ACID,MONOETHYL ESTER
Molecular FormulaC4H12O4N3P1
Molecular Weight197.13
Purity98.00%
Density1.447g/cm3
Boiling Point252.4ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1623-14-9 |
| Catalog No. | 2A-9027150 |
| Chinese Name | 磷酸单乙基酯 |
| Synonyms | monoethyl phosphate; ethyl phosphoric acid; Ethyl phosphate,mono; EINECS 216-603-9; Monoethyl acid phosphate; Phosphorsaeure-monoaethylester; Ethyl dihydrogen phosphate; phosphoric acid triethylester; PHOSPHORIC ACID,MONOETHYL ESTER |
| Molecular Formula | C4H12O4N3P1 |
| Molecular Weight | 197.13 |
| Purity | 98.00 |
| Density | 1.447g/cm3 |
| Boiling Point | 252.4ºC at 760mmHg |
| HTC | 2919900090 |
| PubChem ID | 585704 |
| MDL Number | MFCD00868297 |
| SMILES | [Zn++].CCO[P]([O-])([O-])=O |
| InChI | InChI=1S/C2H7O4P.Zn/c1-2-6-7(3,4)5;/h2H2,1H3,(H2,3,4,5);/q;+2/p-2 |
| InChI Key | InChIKey=UACZWEHNJDEXJP-UHFFFAOYSA-L |
| MSDS | msds/27150_1_1623_14_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Diethyl dimethylmalonate | 1619-62-1 | 2A-9027136 |
| 2,6-Bis(tert-butyl)-4-(mercaptomethyl)phenol | 1620-48-0 | 2A-9027138 |
| 1-Phenyl-2-pyridin-2-ylethanone | 1620-53-7 | 2A-9027139 |
| 2-[2-(2-Thienyl)ethyl]benzoic acid | 1622-54-4 | 2A-9027146 |
| Dibenzyl phosphate | 1623-08-1 | 2A-9027149 |
| 4-Phenoxybenzoyl chloride | 1623-95-6 | 2A-9027152 |
| 4,4'-Di-tert-butylbiphenyl | 1625-91-8 | 2A-9027156 |
| 6-Chlorothymine | 1627-28-7 | 2A-9027157 |
| 1-Penten-3-one | 1629-58-9 | 2A-9027159 |
| 1-Hexen-3-one | 1629-60-3 | 2A-9027160 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA