
CAS Number1613-37-2
Synonymsglyphosate-potassium; 1-oxidoquinolin-1-ium; EINECS 216-560-6; Quinoline 1-oxide; MFCD00006737; Quinoline N-Oxide Hydrate; Glycine, N-(phosphonomethyl)-, potassium salt (1:1); Potassium [(phosphonomethyl)amino]acetate
Molecular FormulaC3H7KNO5P
Molecular Weight145.16 (anhydrous basis)
Purity97%
Density1.13g/cm3
Boiling Point173 °C / 4mmHg
Melting Point52-55 °C (lit.)
AppearanceOcher to brown crystalline powder and lumps
EINECS216-560-6
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1613-37-2 |
| Catalog No. | 2A-9027124 |
| Chinese Name | 喹啉-N-氧化物 |
| Synonyms | glyphosate-potassium; 1-oxidoquinolin-1-ium; EINECS 216-560-6; Quinoline 1-oxide; MFCD00006737; Quinoline N-Oxide Hydrate; Glycine, N-(phosphonomethyl)-, potassium salt (1:1); Potassium [(phosphonomethyl)amino]acetate |
| Molecular Formula | C3H7KNO5P |
| Molecular Weight | 145.16 (anhydrous basis) |
| Purity | 97 |
| Density | 1.13g/cm3 |
| Boiling Point | 173 °C / 4mmHg |
| Melting Point | 52-55 °C (lit.) |
| Appearance | Ocher to brown crystalline powder and lumps |
| Storage Condition | Store under inert gas; avoid moisture (hygroscopic |
| EINECS | 216-560-6 |
| HTC | 2933499090 |
| PubChem ID | 24847482 |
| MDL Number | MFCD00149472 |
| SMILES | [H]O[H].[O-][n+]1cccc2ccccc12 |
| InChI | 1S/C9H7NO.H2O/c11-10-7-3-5-8-4-1-2-6-9(8)10;/h1-7H;1H2 |
| InChI Key | CUSWDTBBCIXCRB-UHFFFAOYSA-N |
| Beilstein/REAXYS | 5989589 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/27124_1_1613_37_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4,6-Dimethylpyrimidine | 1558-17-4 | 2A-9027026 |
| 2,3-Dihydro-2,2-dimethyl-7-benzofuranol | 1563-38-8 | 2A-9027041 |
| 3-Amino-5-phenylpyrazole | 1572-10-7 | 2A-9027063 |
| 2-Fluoropurine | 1598-61-4 | 2A-9027104 |
| Methyl 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indole-3-acetate | 1601-18-9 | 2A-9027107 |
| 1-Aminobenzotriazole | 1614-12-6 | 2A-9027126 |
| 6-Methylpyridine-2-carbonitrile | 1620-75-3 | 2A-9027140 |
| 2-Cyano-5-methylpyridine | 1620-77-5 | 2A-9027142 |
| 5-Pyrazolecarboxylic acid | 1621-91-6 | 2A-9027144 |
| 2-Methoxypyridine | 1628-89-3 | 2A-9027158 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA