CAS Number1539-06-6
Synonyms4-Acetylamino-3-nitro-benzoesaeure; 4-acetylamino-3-nitro-benzoic acid; MFCD00014703; 4-Acetylamino-3-nitrobenzoic acid; 4-Acetamino-3-nitrobenzoic acid; 4-Acetamido-3-nitrobenzoic acid; 3-Nitro-4-acetamino-benzoesaeure; 3-nitro-4-acetamidobenzoic acid; EINECS 216-265-2
Molecular FormulaHOC6H3(NO2)CO2H
Molecular Weight183.12
Purity95%
Density1.5±0.1 g/cm3
Boiling Point497.4±40.0 °C at 760 mmHg
Melting Point229-231 °C (lit.)
AppearanceBeige to yellow crystalline powder
EINECS210-580-9
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1539-06-6 |
| Catalog No. | 2A-9027004 |
| Chinese Name | 4-乙酰氨基-3-硝基苯甲酸 |
| Synonyms | 4-Acetylamino-3-nitro-benzoesaeure; 4-acetylamino-3-nitro-benzoic acid; MFCD00014703; 4-Acetylamino-3-nitrobenzoic acid; 4-Acetamino-3-nitrobenzoic acid; 4-Acetamido-3-nitrobenzoic acid; 3-Nitro-4-acetamino-benzoesaeure; 3-nitro-4-acetamidobenzoic acid; EINECS 216-265-2 |
| Molecular Formula | HOC6H3(NO2)CO2H |
| Molecular Weight | 183.12 |
| Purity | 95 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 497.4±40.0 °C at 760 mmHg |
| Melting Point | 229-231 °C (lit.) |
| Appearance | Beige to yellow crystalline powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| EINECS | 210-580-9 |
| HTC | 2924299090 |
| PubChem ID | 24895657 |
| MDL Number | MFCD00007110 |
| SMILES | OC(=O)c1ccc(c(O)c1)[N+]([O-])=O |
| InChI | 1S/C7H5NO5/c9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-3,9H,(H,10,11) |
| InChI Key | XLDLRRGZWIEEHT-UHFFFAOYSA-N |
| Beilstein/REAXYS | 2107564 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/27004_1_1539_06_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-[2-(Phenylthio)phenyl]acetic acid | 1527-17-9 | 2A-9026979 |
| 1,2,3,4-Tetrabromobutane | 1529-68-6 | 2A-9026983 |
| Methanethiol acetate | 1534-08-3 | 2A-9026996 |
| 3-Dodecanone | 1534-27-6 | 2A-9026997 |
| Trimethylacetic anhydride | 1538-75-6 | 2A-9027003 |
| Ethyl 2-propylacetoacetate | 1540-28-9 | 2A-9027005 |
| Ethyl 2-acetylhexanoate | 1540-29-0 | 2A-9027006 |
| 3-Ethyl-2,4-pentanedione | 1540-34-7 | 2A-9027007 |
| 3,5-Difluoro-4-iodoaniline | 1542-34-3 | 2A-9027008 |
| 7H-Dodecafluoroheptanoic acid | 1546-95-8 | 2A-9027014 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS