
CAS Number109919-26-8
Synonyms2-bromo-6-chloro-4-trifluoromethylaniline; 2-Bromo-6-chloro-4-(trifluoromethyl)aniline; 4-Amino-3-bromo-5-chlorobenzotrifluoride; MFCD00042180
Molecular FormulaC7H4BrClF3N
Molecular Weight274.466
Purity98%
Density1.8±0.1 g/cm3
Boiling Point224.8±40.0 °C at 760 mmHg
Melting Point27-30 °C(lit.)
AppearanceWhite to off-white crystal or low melting point solid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 109919-26-8 |
| Catalog No. | 2A-9002699 |
| Chinese Name | 2-溴-6-氯-4-(三氟甲基)苯胺 |
| Synonyms | 2-bromo-6-chloro-4-trifluoromethylaniline; 2-Bromo-6-chloro-4-(trifluoromethyl)aniline; 4-Amino-3-bromo-5-chlorobenzotrifluoride; MFCD00042180 |
| Molecular Formula | C7H4BrClF3N |
| Molecular Weight | 274.466 |
| Purity | 98 |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 224.8±40.0 °C at 760 mmHg |
| Melting Point | 27-30 °C(lit.) |
| Appearance | White to off-white crystal or low melting point solid |
| Storage Condition | Store airtight in a cool, dry warehouse. Keep away |
| Packaging | III |
| HTC | 2921420090 |
| SMILES | Nc1c(Cl)cc(C(F)(F)F)cc1Br |
| InChI | InChI=1S/C7H4BrClF3N/c8-4-1-3(7(10,11)12)2-5(9)6(4)13/h1-2H,13H2 |
| InChI Key | OVJCOPVKCCJSFE-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| Risk Codes | R36/37/38 |
| Safety Description | S26;S36 |
| MSDS | msds/2699_1_109919_26_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-Bromo-5-(trifluoromethyl)benzonitrile | 1483-55-2 | 2A-9002662 |
| 2-Bromo-5-fluoro-4-methylbenzaldehyde | 2A-102672 | 2A-9002672 |
| 2-Bromo-5-fluorobenzaldehyde | 94569-84-3 | 2A-9002676 |
| 2-Bromo-5-hydroxy-4-methoxybenzaldehyde | 2973-59-3 | 2A-9002687 |
| 2-Bromo-5-pyridylboronic acid pinacol ester | 214360-62-0 | 2A-9002696 |
| 2-Bromo-6-fluorobenzaldehyde | 360575-28-6 | 2A-9002707 |
| 2-Bromomethylnaphthalene | 939-26-4 | 2A-9002747 |
| 2-Butyl-[1,3,2]dioxaborolane-4,5-dicarboxylic acid bis-dimethylamide | 161344-85-0 | 2A-9002764 |
| 2-Carbmethoxycyclopentanone(Methyl 2-cyclopentanonecarboxylate) | 10472-24-9 | 2A-9002773 |
| 2-Carboxyphenylboronic acid | 149105-19-1 | 2A-9002776 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA