
CAS Number1484-27-1
SynonymsMFCD07369912; 3-Brom-indol; 3-brom-1H-indole; 1H-Indole,3-bromo; 3-Bromo-1H-indole; 3-bromoindole; 3-bromo-indole
Molecular FormulaC8H6BrN
Molecular Weight224.05
Purity98%
Density1.7±0.1 g/cm3
Boiling Point316.9±15.0 °C at 760 mmHg
Melting Point204-207 °C (lit.)
EINECS212-884-7
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1484-27-1 |
| Catalog No. | 2A-0202343 |
| Chinese Name | 3-溴吲哚 |
| Synonyms | MFCD07369912; 3-Brom-indol; 3-brom-1H-indole; 1H-Indole,3-bromo; 3-Bromo-1H-indole; 3-bromoindole; 3-bromo-indole |
| Molecular Formula | C8H6BrN |
| Molecular Weight | 224.05 |
| Purity | 98 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 316.9±15.0 °C at 760 mmHg |
| Melting Point | 204-207 °C (lit.) |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| EINECS | 212-884-7 |
| HTC | 2933990090 |
| PubChem ID | 24874042 |
| MDL Number | MFCD00152016 |
| SMILES | [H]C(=O)c1c[nH]c2ccc(Br)cc12 |
| InChI | 1S/C9H6BrNO/c10-7-1-2-9-8(3-7)6(5-12)4-11-9/h1-5,11H |
| InChI Key | PEENKJZANBYXNB-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/26911_1_1484_27_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| cis-Octahydroisoindole | 1470-99-1 | 2A-9026879 |
| 3-Indoleglyoxylic acid | 1477-49-2 | 2A-9026886 |
| 3-Chloro-2-fluoro-pyridine | 1480-64-4 | 2A-9026891 |
| 2-Fluoro-3-nitropyridine | 1480-87-1 | 2A-9026893 |
| 6-Fluoropurine | 1480-89-3 | 2A-9026894 |
| 2-Piperidineethanol | 1484-84-0 | 2A-9026913 |
| 4-Chloro-2-trifluoromethyl-pyrimidine | 1514-96-1 | 2A-9026956 |
| 1-Cyanopyrrolidine | 1530-88-7 | 2A-9026986 |
| 1-Aminoisoquinoline | 1532-84-9 | 2A-9026990 |
| 4-Chloroisoquinoline | 1532-91-8 | 2A-9026991 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA