
CAS Number56658-04-9
Synonyms1-(2-bromo-5-methoxy)benzoyl chloride; 2-bromanyl-5-methoxy-benzoyl chloride; 2-bromo-5-methoxybenzene-1-carbonylchloride; 5-methoxy-2-bromobenzoyl chloride; 2-bromo-5-methoxybenzoic acid chloride; MFCD00219937; 2-bromo-5-methoxy-benzoyl chloride
Molecular FormulaC8H6BrClO2
Molecular Weight249.493
Purity97%
Density1.598g/cm3
Boiling Point110 °C
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 56658-04-9 |
| Catalog No. | 2A-9002691 |
| Chinese Name | 2-溴-5-甲氧基苯-1-甲酰氯 |
| Synonyms | 1-(2-bromo-5-methoxy)benzoyl chloride; 2-bromanyl-5-methoxy-benzoyl chloride; 2-bromo-5-methoxybenzene-1-carbonylchloride; 5-methoxy-2-bromobenzoyl chloride; 2-bromo-5-methoxybenzoic acid chloride; MFCD00219937; 2-bromo-5-methoxy-benzoyl chloride |
| Molecular Formula | C8H6BrClO2 |
| Molecular Weight | 249.493 |
| Purity | 97 |
| Density | 1.598g/cm3 |
| Boiling Point | 110 °C |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| Packaging | II |
| HTC | 2918990090 |
| MDL Number | MFCD02063083 |
| SMILES | COc1ccc(Br)c(C(=O)Cl)c1 |
| InChI | InChI=1S/C8H6BrClO2/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4H,1H3 |
| InChI Key | RZCQJXVXRYIJQE-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/2691_1_56658_04_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Bromo-5-fluorobenzoyl chloride | 111771-13-2 | 2A-9002680 |
| 2-Bromo-5-fluorobenzyl bromide | 112399-50-5 | 2A-9002681 |
| 2-Bromo-5-fluoronitrobenzene | 446-09-3 | 2A-9002682 |
| 2-Bromo-5-fluorophenol | 147460-41-1 | 2A-9002683 |
| 2-Bromo-5-iodobenzoic acid | 25252-00-0 | 2A-9002689 |
| 2-Bromo-5-nitrobenzotrifluoride | 367-67-9 | 2A-9002693 |
| 2'-Bromo-6'-chloro-2,2,2-trifluoro acetophenone | 2A-102698 | 2A-9002698 |
| 2-Bromo-6-chloro-4-fluoroaniline | 201849-14-1 | 2A-9002700 |
| 2-Bromo-6-chlorobenzoic acid | 93224-85-2 | 2A-9002701 |
| 2-Bromo-6-chlorobenzoyl chloride | 116529-65-8 | 2A-9002702 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA