
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1469-74-5 |
| Catalog No. | 2A-9026876 |
| Chinese Name | 3,4'-二硝基二苯甲酮 |
| Synonyms | (3-nitrophenyl)-(4-nitrophenyl)methanone; 3,4'-DINITROBENZOPHENONE; MFCD00617174 |
| Molecular Formula | C13H8N2O5 |
| Molecular Weight | 272.21300 |
| Purity | 98.00 |
| Density | 1.423 g/cm3 |
| Boiling Point | 471.393ºC at 760 mmHg |
| Melting Point | 173 °C |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | II |
| HTC | 29211190 |
| PubChem ID | 38474589 |
| InChI | InChI=1S/C13H8N2O5/c16-13(9-4-6-11(7-5-9)14(17)18)10-2-1-3-12(8-10)15(19)20/h1-8H |
| InChI Key | ZEGCOKXUTZGBGN-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Division 1 Flammable solids. UN number: 1325 Formal shipping name: Combustible solid, organic, not otherwise specified. Packing grade: II |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Ethylcyclopentanol | 1462-96-0 | 2A-9026861 |
| Selenomethionine | 1464-42-2 | 2A-9026865 |
| N-(1-Naphthyl)ethylenediamine dihydrochloride | 1465-25-4 | 2A-9026868 |
| 2,6-Dimethoxybenzoic acid | 1466-76-8 | 2A-9026869 |
| 2-Bromo-1-(3-thienyl)-1-ethanone | 1468-82-2 | 2A-9026872 |
| 2,4,4'-Trihydroxybenzophenone | 1470-79-7 | 2A-9026877 |
| 5-Hydroxyindane | 1470-94-6 | 2A-9026878 |
| N,N'-Ethylenebisacetoacetamide | 1471-94-9 | 2A-9026880 |
| Ethyl diethoxyphosphinylformate | 1474-78-8 | 2A-9026881 |
| cis-1,4-Dichloro-2-butene | 1476-11-5 | 2A-9026882 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA