
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1457-46-1 |
| Catalog No. | 2A-9026839 |
| Chinese Name | 3-苯基-2-硫酮-1,3-噻唑啉-4-酮 |
| Synonyms | N-PHENYL-RHODANINE; 3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one; EINECS 215-940-9 |
| Molecular Formula | C9H7NOS2 |
| Molecular Weight | 209.29 |
| Purity | 98.00 |
| Density | 1.45g/cm3 |
| Boiling Point | 322ºC at 760mmHg |
| Melting Point | 190-194ºC |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2934999090 |
| PubChem ID | 80821 |
| MDL Number | MFCD00100196 |
| SMILES | O=C1CSC(=S)N1c1ccccc1 |
| InChI | InChI=1S/C9H7NOS2/c11-8-6-13-9(12)10(8)7-4-2-1-3-5-7/h1-5H,6H2 |
| InChI Key | DVRWEKGUWZINTQ-UHFFFAOYSA-N |
| MSDS | msds/26839_1_1457_46_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Polymer Intermediates | ||
|---|---|---|
| gamma-Decalactone | 706-14-9 | 2A-9025006 |
| Diethylene glycol divinyl ether | 764-99-8 | 2A-9025121 |
| cis-1,2,3,6-Tetrahydrophthalic anhydride | 935-79-5 | 2A-9025702 |
| 4-Chloroformylphthalic anhydride | 1204-28-0 | 2A-9026492 |
| N-Aminorhodanine | 1438-16-0 | 2A-9026799 |
| 3-Allylrhodanine | 1457-47-2 | 2A-9026840 |
| tert-Butyl acrylate | 1663-39-4 | 2A-9027221 |
| Triethylene glycol diacrylate | 1680-21-3 | 2A-9027270 |
| 4-Chloro-alpha-methylstyrene | 1712-70-5 | 2A-9027340 |
| Diallyl bisphenol A | 1745-89-7 | 2A-9027405 |
| Browse all Polymer Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA