
CAS Number1449-46-3
SynonymsBenzyl triphenyl phosphonium bromide; Benzyltriphenylphosphonium Bromide; EINECS 215-908-4; MFCD00031707; (Phenylmethyl)triphenylphosphonium bromide Bromo(benzyl)triphenylphosphorane; Phosphonium, triphenyl(phenylmethyl)-, bromide (1:1); Benzyl(triphenyl)phosphonium bromide; benzyl(triphenyl)phosphanium,bromide
Molecular FormulaC6H5CH2P(Br)(C6H5)3
Molecular Weight433.32
Purity96%
Melting Point295-298 °C (lit.)
Appearancesolid
EINECS215-908-4
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1449-46-3 |
| Catalog No. | 2A-9026818 |
| Chinese Name | 苄基三苯基溴化膦 |
| Synonyms | Benzyl triphenyl phosphonium bromide; Benzyltriphenylphosphonium Bromide; EINECS 215-908-4; MFCD00031707; (Phenylmethyl)triphenylphosphonium bromide Bromo(benzyl)triphenylphosphorane; Phosphonium, triphenyl(phenylmethyl)-, bromide (1:1); Benzyl(triphenyl)phosphonium bromide; benzyl(triphenyl)phosphanium,bromide |
| Molecular Formula | C6H5CH2P(Br)(C6H5)3 |
| Molecular Weight | 433.32 |
| Purity | 96 |
| Melting Point | 295-298 °C (lit.) |
| Appearance | solid |
| Water Solubility | Soluble in: methanol |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | III |
| EINECS | 215-908-4 |
| HTC | 2931900090 |
| PubChem ID | 24866908 |
| MDL Number | MFCD00031707 |
| SMILES | [Br-].C(c1ccccc1)[P+](c2ccccc2)(c3ccccc3)c4ccccc4 |
| InChI | 1S/C25H22P.BrH/c1-5-13-22(14-6-1)21-26(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25;/h1-20H,21H2;1H/q+1;/p-1 |
| InChI Key | WTEPWWCRWNCUNA-UHFFFAOYSA-M |
| Beilstein/REAXYS | 3599867 |
| NACRES Code | NA.22 |
| UNSPSC | 12352002 |
| MSDS | msds/26818_1_1449_46_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | AB (Inbound cargo customs clearance form) |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Plastic & Specialty Additives | ||
|---|---|---|
| Hexaphenyl cyclotriphosphazene | 1110-78-7 | 2A-9026129 |
| 4,4',4''-Trimethyltriphenylamine | 1159-53-1 | 2A-9026355 |
| Decabromodiphenyl oxide | 1163-19-5 | 2A-9026359 |
| Acetonyltriphenylphosphonium chloride | 1235-21-8 | 2A-9026533 |
| 1-(Triphenylphosphoranylidene)acetone | 1439-36-7 | 2A-9026804 |
| 1,1,3-Triphenylpropargyl alcohol | 1522-13-0 | 2A-9026969 |
| Ethyltriphenylphosphonium bromide | 1530-32-1 | 2A-9026984 |
| (Carbethoxymethyl)triphenylphosphonium bromide | 1530-45-6 | 2A-9026985 |
| Allyltriphenylphosphonium bromide | 1560-54-9 | 2A-9027037 |
| Bromotriphenylethylene | 1607-57-4 | 2A-9027116 |
| Browse all Plastic & Specialty Additives products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA