
CAS Number1273-82-1
Synonymscyclopenta-1,3-dien-1-amine,cyclopenta-1,3-diene,iron(2+); Ferrocenylamine; Iron(2+) 2-amino-2,4-cyclopentadienide 2,4-cyclopentadienide (1:1:1)
Molecular FormulaC10H11FeN
Molecular Weight201.05
Purity≥98.0 (T)%
Melting Point157-158°C
AppearanceSolid;Light yellow to Brown to Dark green powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1273-82-1 |
| Catalog No. | 2A-9026564 |
| Chinese Name | 氨基二茂铁 |
| Synonyms | cyclopenta-1,3-dien-1-amine,cyclopenta-1,3-diene,iron(2+); Ferrocenylamine; Iron(2+) 2-amino-2,4-cyclopentadienide 2,4-cyclopentadienide (1:1:1) |
| Molecular Formula | C10H11FeN |
| Molecular Weight | 201.05 |
| Purity | ≥98.0 (T) |
| Melting Point | 157-158°C |
| Appearance | Solid;Light yellow to Brown to Dark green powder to crystal |
| Storage Condition | Refrigerator |
| HTC | 2942000000 |
| PubChem ID | 329748421 |
| MDL Number | MFCD03844760 |
| SMILES | N[C]1[C][C][C][C]1.[C]2[C][C][C][C]2.[Fe] |
| InChI | 1S/C5H6N.C5H5.Fe/c6-5-3-1-2-4-5;1-2-4-5-3-1;/h1-4H,6H2;1-5H; |
| InChI Key | JETZZOFQXXBFDQ-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 41116105 |
| MSDS | msds/26564_1_1273_82_1.pdf |
| Transport Info | Product Name: Aminoferrocene |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Bis(cyclopentadienyl)dimethyltitanium | 1271-66-5 | 2A-9026559 |
| N,N-Dimethylaminomethylferrocene | 1271-86-9 | 2A-9026560 |
| Butyrylferrocene | 1271-94-9 | 2A-9026561 |
| Benzoylferrocene | 1272-44-2 | 2A-9026562 |
| Bromoferrocene | 1273-73-0 | 2A-9026563 |
| Ethylferrocene | 1273-89-8 | 2A-9026566 |
| 1,1'-Diacetylferrocene | 1273-94-5 | 2A-9026567 |
| 1,1'-Diethylferrocene | 1273-97-8 | 2A-9026568 |
| Ruthenocene | 1287-13-4 | 2A-9026570 |
| Ferroceneacetic acid | 1287-16-7 | 2A-9026571 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA