
CAS Number1188-33-6
SynonymsDimethylformamide diethyl acetal; N,N-Dimethylformamide diethyl acetal; Diethoxy-N,N-dimethylmethanamine; Bredereck's reagent; 1,1-Diethoxy-N,N-dimethylmethanamine; EINECS 214-707-9; DMF-Diethyl acetal; 1,1-Diethoxytrimethylamine; dimethylformamide dlethyl acetal; N,N-Dimethyldiethoxymethanamine; Diethoxymethyldimethylamine; N,N-Dimethyformamide Diethy Acetal; N,N-Dimethyformamide; 1,1-Diethoxytrimethylamine,1,1-Diethoxy-N,N-dimethylmethylamine; MFCD00009232; N,N-DIMETHYLDIETHOXYMETHYLAMINE
Molecular Formula(CH3)2NCH(OC2H5)2
Molecular Weight147.22
Purity98.00%
Density0.9±0.1 g/cm3
Boiling Point130.3±0.0 °C at 760 mmHg
AppearanceTransparent light yellow liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1188-33-6 |
| Catalog No. | 2A-9026400 |
| Chinese Name | N,N-二甲基甲酰胺二乙基缩醛 |
| Synonyms | Dimethylformamide diethyl acetal; N,N-Dimethylformamide diethyl acetal; Diethoxy-N,N-dimethylmethanamine; Bredereck's reagent; 1,1-Diethoxy-N,N-dimethylmethanamine; EINECS 214-707-9; DMF-Diethyl acetal; 1,1-Diethoxytrimethylamine; dimethylformamide dlethyl acetal; N,N-Dimethyldiethoxymethanamine; Diethoxymethyldimethylamine; N,N-Dimethyformamide Diethy Acetal; N,N-Dimethyformamide; 1,1-Diethoxytrimethylamine,1,1-Diethoxy-N,N-dimethylmethylamine; MFCD00009232; N,N-DIMETHYLDIETHOXYMETHYLAMINE |
| Molecular Formula | (CH3)2NCH(OC2H5)2 |
| Molecular Weight | 147.22 |
| Purity | 98.00 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 130.3±0.0 °C at 760 mmHg |
| Appearance | Transparent light yellow liquid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | II |
| HTC | 29225000 |
| PubChem ID | 329755961 |
| SMILES | CCOC(OCC)N(C)C |
| InChI | InChI=1S/C7H17NO2/c1-5-9-7(8(3)4)10-6-2/h7H,5-6H2,1-4H3 |
| InChI Key | BWKAYBPLDRWMCJ-UHFFFAOYSA-N |
| Hazard Symbols | 3 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 95.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations Classification: Class 3 Flammable Liquids. UN number: 1993 Proper shipping name: Flammable Liquid, not otherwise specified Packing grade: II |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| Benzaldehyde dimethyl acetal | 1125-88-8 | 2A-9026254 |
| Methyl 3-(bromomethyl)benzoate | 1129-28-8 | 2A-9026276 |
| 3-Ethoxy-4-methoxybenzaldehyde | 1131-52-8 | 2A-9026286 |
| 2,6-Naphthalenedicarboxylic acid | 1141-38-4 | 2A-9026319 |
| Trifluoromethyl trifluorovinyl ether | 1187-93-5 | 2A-9026396 |
| 1-Cyclohexene-1-carboxaldehyde | 1192-88-7 | 2A-9026419 |
| 2,5-Dihydroxybenzaldehyde | 1194-98-5 | 2A-9026436 |
| 2-Methoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | 1195-66-0 | 2A-9026442 |
| 5-Norbornene-2-endo,3-exo-dicarboxylic acid | 1200-88-0 | 2A-9026476 |
| Ethyl 4-chloromethylbenzoate | 1201-90-7 | 2A-9026483 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA