
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1151-14-0 |
| Catalog No. | 2A-9026341 |
| Chinese Name | 2-(4-乙基苯甲酰)苯甲酸 |
| Synonyms | 4'-Aethyl-o-benzoyl-benzoesaeure; 4'-ethyl-benzophenone-2-carboxylic acid; 2-<4-Ethyl-benzoyl>-benzoesaeure; EINECS 214-566-3 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.29 |
| Purity | 98.00 |
| Density | 1.194 g/cm3 |
| Boiling Point | 459.6ºC at 760 mmHg |
| HTC | 2918300090 |
| PubChem ID | 3178880 |
| MDL Number | MFCD00020288 |
| SMILES | CCc1ccc(C(=O)c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C16H14O3/c1-2-11-7-9-12(10-8-11)15(17)13-5-3-4-6-14(13)16(18)19/h3-10H,2H2,1H3,(H,18,19) |
| InChI Key | JZFDKGFWNSQAHU-UHFFFAOYSA-N |
| MSDS | msds/26341_1_1151_14_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Nitrobenzophenone | 1144-74-7 | 2A-9026329 |
| 4-Benzylbenzenesulfonamide | 1145-60-4 | 2A-9026330 |
| 1-Benzyloxy-4-nitrobenzene | 1145-76-2 | 2A-9026331 |
| Glyoxalbis(2-hydroxyanil) | 1149-16-2 | 2A-9026336 |
| Estratetraenol | 1150-90-9 | 2A-0200677 |
| Bis(2-nitrophenyl) disulfide | 1155-00-6 | 2A-9026346 |
| 1-Benzyl-N-phenylpiperidin-4-amine | 1155-56-2 | 2A-9026347 |
| 2,2-Bis-(4-cyanatophenyl)propane | 1156-51-0 | 2A-9026350 |
| 4-Androstenediol | 1156-92-9 | 2A-9026351 |
| Clemizole hydrochloride | 1163-36-6 | 2A-9026360 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA