
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1134-50-5 |
| Catalog No. | 2A-9026303 |
| Chinese Name | 1-苯基-1H-吡唑-4-甲酸 |
| Synonyms | EINECS 413-030-8; MFCD00514518; 1-phenylpyrazole-4-carboxylic acid |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 |
| Purity | 98.00 |
| Density | 1.28g/cm3 |
| Boiling Point | 379.6ºC at 760 mmHg |
| Melting Point | 222-227℃ |
| Appearance | Light yellow powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2933199090 |
| PubChem ID | 10239397 |
| SMILES | O=C(O)c1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C10H8N2O2/c13-10(14)8-6-11-12(7-8)9-4-2-1-3-5-9/h1-7H,(H,13,14)/p-1 |
| InChI Key | ZROILLPDIUNLSE-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| Benzo[b]thiophene-3(2H)-one 1,1-dioxide | 1127-35-1 | 2A-9026265 |
| 1-Phenyl-3-aminopyrazole | 1128-56-9 | 2A-9026271 |
| 5-Amino-3-methyl-1-phenylpyrazole | 1131-18-6 | 2A-9026285 |
| 4-Phenylpyridine-N-oxide | 1131-61-9 | 2A-9026288 |
| 2,3,4,5-Tetrachloro-6-(trichloromethyl)pyridine | 1134-04-9 | 2A-9026298 |
| 5-Methyl-3-phenylisoxazole-4-carboxylic acid | 1136-45-4 | 2A-9026308 |
| 2-(3-Pyridyl)-1H-benzimidazole | 1137-67-3 | 2A-9026313 |
| 6-Acetamido-4-hydroxy-2-methylquinoline | 1140-81-4 | 2A-9026317 |
| Ethyl 5-methyl-3-phenylisoxazole-4-carboxylate | 1143-82-4 | 2A-9026327 |
| 2,2':6',2''-Terpyridine | 1148-79-4 | 2A-9026335 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA