
CAS Number1113-63-9
SynonymsMethylmalonsaeureamid; 2-METHYLPROPANEDIAMIDE; methylmalondiamide; methyl propanediamide; Methylmalonamide; 2-METHYLMALONODIAMIDE; methyl-malonic acid diamide; MFCD00043625; Methyl-malonsaeure-diamid; Ethane-1,1-dicarboxamide; N-METHYL MALONAMIDE
Molecular FormulaC4H8N2O2
Molecular Weight116.11900
Purity98.00%
Density1.202g/cm3
Boiling Point400.3ºC at 760 mmHg
Melting Point208-210°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1113-63-9 |
| Catalog No. | 2A-9026143 |
| Chinese Name | 2-甲基丙二酰胺 |
| Synonyms | Methylmalonsaeureamid; 2-METHYLPROPANEDIAMIDE; methylmalondiamide; methyl propanediamide; Methylmalonamide; 2-METHYLMALONODIAMIDE; methyl-malonic acid diamide; MFCD00043625; Methyl-malonsaeure-diamid; Ethane-1,1-dicarboxamide; N-METHYL MALONAMIDE |
| Molecular Formula | C4H8N2O2 |
| Molecular Weight | 116.11900 |
| Purity | 98.00 |
| Density | 1.202g/cm3 |
| Boiling Point | 400.3ºC at 760 mmHg |
| Melting Point | 208-210°C |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| HTC | 2924199090 |
| PubChem ID | 82641 |
| SMILES | CC(C(N)=O)C(N)=O |
| InChI | InChI=1S/C4H8N2O2/c1-2(3(5)7)4(6)8/h2H,1H3,(H2,5,7)(H2,6,8) |
| InChI Key | CGRKYGKHZOCPSZ-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Tetraallylsilane | 1112-66-9 | 2A-9026136 |
| 1-(4-IODO-PHENYL)-PIPERIDIN-2-ONE | 385425-15-0 | 2A-9026138 |
| Ammonium oxalate | 1113-38-8 | 2A-9026140 |
| L-Penicillamine | 1113-41-3 | 2A-9026141 |
| Bromopyruvic acid | 1113-59-3 | 2A-9026142 |
| N-Methyldiacetamide | 1113-68-4 | 2A-9026144 |
| N-Glycolylneuraminic acid | 1113-83-3 | 2A-9026145 |
| Muramic acid | 1114-41-6 | 2A-9026147 |
| N,N-Diethylpropionamide | 1114-51-8 | 2A-9026148 |
| L-Aspartic acid potassium salt | 1115-63-5 | 2A-9026152 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA