
CAS Number1090-13-7
SynonymsTetracenequinone; 2,3-Benzo-9,10-anthraquinone; tetracene-5,12-dione; 5,12-Naphthacenedione; 5,12-NAPHTHACENEQUINONE; MFCD00003701; 5,12-Tetracenedione
Molecular FormulaC18H10O2
Molecular Weight258.271
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point472.5±15.0 °C at 760 mmHg
Melting Point282-286ºC
AppearanceKhaki powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1090-13-7 |
| Catalog No. | 2A-9026105 |
| Chinese Name | 5,12-萘并萘醌 |
| Synonyms | Tetracenequinone; 2,3-Benzo-9,10-anthraquinone; tetracene-5,12-dione; 5,12-Naphthacenedione; 5,12-NAPHTHACENEQUINONE; MFCD00003701; 5,12-Tetracenedione |
| Molecular Formula | C18H10O2 |
| Molecular Weight | 258.271 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 472.5±15.0 °C at 760 mmHg |
| Melting Point | 282-286ºC |
| Appearance | Khaki powder |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| HTC | 2914690090 |
| PubChem ID | 472149 |
| SMILES | O=C1c2ccccc2C(=O)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C18H10O2/c19-17-13-7-3-4-8-14(13)18(20)16-10-12-6-2-1-5-11(12)9-15(16)17/h1-10H |
| InChI Key | LZPBKINTWROMEA-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 95.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Diethyl benzylphosphonate | 1080-32-6 | 2A-9026093 |
| N-[(4-Methylphenyl)sulfonyl]glycine | 1080-44-0 | 2A-9026094 |
| Tramazoline | 198211-38-0 | 2A-9026099 |
| Butyl 3,4,5-trihydroxybenzoate | 1083-41-6 | 2A-9026100 |
| Diallyl isophthalate | 1087-21-4 | 2A-9026103 |
| 2-Dimethylaminosulfonylphenthiazine | 1090-78-4 | 2A-9026107 |
| Clostebol | 1093-58-9 | 2A-9026108 |
| 2,2-Bis(4-methylphenyl)hexafluoropropane | 1095-77-8 | 2A-9026110 |
| 2,2-Bis(4-aminophenyl)hexafluoropropane | 1095-78-9 | 2A-9026111 |
| Methadone hydrochloride | 1095-90-5 | 2A-9026112 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA