
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4697-62-5 |
| Catalog No. | 2A-0202324 |
| Chinese Name | 2-溴-4,5-甲氧基苯乙酸 |
| Synonyms | 2-(2-bromo-4,5-dimethoxyphenyl)acetic acid; MFCD00016819 |
| Molecular Formula | C10H11BrO4 |
| Molecular Weight | 275.101 |
| Purity | 98 |
| Density | 1.519g/cm3 |
| Boiling Point | 377.1ºC at 760mmHg |
| Melting Point | 94ºC |
| Storage Condition | 2-8°C |
| HTC | 2918990090 |
| MDL Number | MFCD00016819 |
| SMILES | COc1cc(Br)c(CC(=O)O)cc1OC |
| InChI | InChI=1S/C10H11BrO4/c1-14-8-3-6(4-10(12)13)7(11)5-9(8)15-2/h3,5H,4H2,1-2H3,(H,12,13) |
| InChI Key | MDOLAGJKKZEHHW-UHFFFAOYSA-N |
| MSDS | msds/2601_1_4697_62_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Bromo-3'-nitroacetophenone | 2227-64-7 | 2A-9002587 |
| 2-Bromo-3-nitrobenzoic acid | 573-54-6 | 2A-9002588 |
| 2-Bromo-4-(trifluoromethoxy)aniline | 175278-17-8 | 2A-9002595 |
| 2-Bromo-4,5-difluorophenol | 166281-37-4 | 2A-9002599 |
| 2-Bromo-4,5-dimethoxybenzoic acid | 6286-46-0 | 2A-9002600 |
| 2-Bromo-4,5-dimethoxyphenylacetonitrile | 51655-39-1 | 2A-9002602 |
| 2-Bromo-4,5-ethylenedioxyacetophenone ( 1-(7-Bromo-2,3-dihydro-1,4-benzodioxin-6-yl)ethanone ) | 59820-90-5 | 2A-9002603 |
| 2-Bromo-4,6-dichloroaniline | 697-86-9 | 2A-9002604 |
| 2-Bromo-4,6-dichlorobenzenesulfonylchloride | 351003-53-7 | 2A-9002605 |
| 2-Bromo-4,6-difluoroaniline hydrobromide | 101471-20-9 | 2A-9002606 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA