
CAS Number54403-98-4
SynonymsWSGR BE DXFFF; 2-Bromo-4-(trifluoromethyl)benzenesulphonyl chloride; MFCD03094394; 2-Bromo-4-(trifluoromethyl)benzenesulfonyl chloride
Molecular FormulaC7H3O2Cl1Br1S1F3
Molecular Weight323.52
Purity97%
Density1.8±0.1 g/cm3
Boiling Point294.0±40.0 °C at 760 mmHg
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 54403-98-4 |
| Catalog No. | 2A-9002597 |
| Chinese Name | 2-溴-4-(三氟甲基)苯磺酰氯 |
| Synonyms | WSGR BE DXFFF; 2-Bromo-4-(trifluoromethyl)benzenesulphonyl chloride; MFCD03094394; 2-Bromo-4-(trifluoromethyl)benzenesulfonyl chloride |
| Molecular Formula | C7H3O2Cl1Br1S1F3 |
| Molecular Weight | 323.52 |
| Purity | 97 |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 294.0±40.0 °C at 760 mmHg |
| Storage Condition | Keep receptacle sealed Store in a compact containe |
| Packaging | III |
| HTC | 2904909090 |
| UN(IATA) | UN 2920 |
| MDL Number | MFCD03094394 |
| SMILES | O=S(=O)(Cl)c1ccc(C(F)(F)F)cc1Br |
| InChI Key | WWEGTYZLWBOTQW-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| Risk Codes | R10-34 |
| Safety Description | S26-27-36/37/39-45 |
| MSDS | msds/2597_1_54403_98_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-Bromo-2'-nitro-4'-(trifluoromethyl)diphenyl ether | 2069-14-9 | 2A-9002570 |
| 2-Bromo-3,5-bis(trifluoromethyl)aniline | 174824-16-9 | 2A-9002575 |
| 2-Bromo-3-fluorobenzaldehyde | 2A-102580 | 2A-9002580 |
| 2-Bromo-3-phenylacrylaldehyde | 5443-49-2 | 2A-9002591 |
| 2-Bromo-4-(trifluoromethyl)acetanilide | 3823-19-6 | 2A-9002596 |
| 2-Bromo-4-(trifluoromethyl)benzonitrile | 35764-15-9 | 2A-9002598 |
| 2-Bromo-4-fluoro-5-methylbenzaldehyde | 2A-102624 | 2A-9002624 |
| 2-Bromo-4-fluoro-6-(trifluoromethyl)aniline | 875664-27-0 | 2A-9002626 |
| 2-Bromo-4-fluoro-6-methylbenzaldehyde | 916792-19-3 | 2A-9002628 |
| 2-Bromo-4-fluorobenzaldehyde | 59142-68-6 | 2A-9002633 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA