
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1013-22-5 |
| Catalog No. | 2A-9025938 |
| Chinese Name | 1-(2,3-二甲基苯基)哌啶 |
| Synonyms | o,m-dimethylphenylpiperazine; EINECS 213-794-0; MFCD00040730 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.291 |
| Purity | 98.00 |
| Density | 0.999 g/cm3 |
| Boiling Point | 95 °C |
| Appearance | Transparent yellow |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| HTC | 2933599090 |
| MDL Number | MFCD00040730 |
| SMILES | Cc1cccc(N2CCNCC2)c1C |
| InChI | InChI=1S/C12H18N2/c1-10-4-3-5-12(11(10)2)14-8-6-13-7-9-14/h3-5,13H,6-9H2,1-2H3 |
| InChI Key | LIKXJDINUMWKQA-UHFFFAOYSA-N |
| MSDS | msds/25938_1_1013_22_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1-(4-Pyridyl)piperazine | 1008-91-9 | 2A-0202129 |
| 1-(2-Bromophenyl)piperazine | 1011-13-8 | 2A-9025929 |
| 1-(2-Fluorophenyl)piperazine | 1011-15-0 | 2A-9025930 |
| N-(2-Fluorophenyl)piperazine hydrochloride | 1011-16-1 | 2A-9025931 |
| 2-Phenylthiazole-5-carbaldehyde | 1011-40-1 | 2A-9025932 |
| Dibenzothiophene sulfone | 1016-05-3 | 2A-9025945 |
| 2,5-Bis(4-nitrophenyl)-1,3,4-oxadiazole | 1044-49-1 | 2A-9025971 |
| 2-Ethylimidazole | 1072-62-4 | 2A-9026021 |
| Vinylimidazole | 1072-63-5 | 2A-9026022 |
| 3-Amino-5-methylisoxazole | 1072-67-9 | 2A-9026023 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA