
CAS Number948-65-2
SynonymsEINECS 213-436-3; MFCD00005608; 2-Phenyl-1H-indole; A-PHENYLINDOL; 2-phenyl-indol; a-Phenylindole; Indole,2-phenyl; 2-pPhenyl-1H-indole; 2-phenyl-1h-indol; 2-Phenylindole; Stabilizer I; 2-phenyl-indole
Molecular FormulaC14H11N
Molecular Weight193.24
Purity95%
Density1.2±0.1 g/cm3
Boiling Point250 °C/10 mmHg (lit.)
Melting Point188-190 °C (lit.)
Appearancepowder
EINECS213-436-3
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 948-65-2 |
| Catalog No. | 2A-9025765 |
| Chinese Name | 2-苯基吲哚 |
| Synonyms | EINECS 213-436-3; MFCD00005608; 2-Phenyl-1H-indole; A-PHENYLINDOL; 2-phenyl-indol; a-Phenylindole; Indole,2-phenyl; 2-pPhenyl-1H-indole; 2-phenyl-1h-indol; 2-Phenylindole; Stabilizer I; 2-phenyl-indole |
| Molecular Formula | C14H11N |
| Molecular Weight | 193.24 |
| Purity | 95 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 250 °C/10 mmHg (lit.) |
| Melting Point | 188-190 °C (lit.) |
| Appearance | powder |
| Storage Condition | Keep container tightly sealed and store in a cool, |
| EINECS | 213-436-3 |
| HTC | 2933990090 |
| PubChem ID | 24898346 |
| MDL Number | MFCD00005608 |
| SMILES | c1ccc(cc1)-c2cc3ccccc3[nH]2 |
| InChI | 1S/C14H11N/c1-2-6-11(7-3-1)14-10-12-8-4-5-9-13(12)15-14/h1-10,15H |
| InChI Key | KLLLJCACIRKBDT-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/25765_1_948_65_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 99.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 8-Methoxyquinoline | 938-33-0 | 2A-9025718 |
| 6-Dimethylaminopurine | 938-55-6 | 2A-9025719 |
| 2-Cyano-6-hydroxybenzothiazole | 939-69-5 | 2A-0200679 |
| Methyl indole-3-carboxylate | 942-24-5 | 2A-9025741 |
| 2-Cyano-6-methoxybenzothiazole | 943-03-3 | 2A-9025744 |
| 1,3,5-Triacryloylhexahydro-1,3,5-triazine | 959-52-4 | 2A-9025786 |
| 4-Anilino-1-benzyl-4-cyanopiperidine | 968-86-5 | 2A-9025798 |
| 2,2'-Biquinoline-4,4-dicarboxylic acid disodium salt | 979-88-4 | 2A-9025813 |
| 2,4-Bis(octylthio)-6-(4-hydroxy-3,5-di-tert-butylanilino)-1,3,5-triazine | 991-84-4 | 2A-9025827 |
| 5-Bromo-1-methylimidazole | 1003-21-0 | 2A-9025869 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA