
CAS Number925-21-3
Synonymsbutyl hydrogen maleate; maleic acid,butyl ester; (2Z)-4-Butoxy-4-oxobut-2-enoic acid; maleic acid N-(4-methoxyphenyl)isoimide; Maleinsaeure-monobutylester; EINECS 213-116-3; N-(4-Methoxyphenyl)-maleisoimid; 4'-Methoxyisomaleanilide; 5-(4-methoxyphenylimino)-5H-furan-2-one; N-(4-Methoxyphenyl)-maleinisoimid; MFCD00040407; maleic acid monobutyl ester; (5e)-5-[(4-methoxyphenyl)imino]furan-2(5h)-one; n-butyl maleate; (2Z)-4-Butoxy-4-oxo-2-butenoic acid
Molecular FormulaC8H12O4
Molecular Weight172.178
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point289.1±23.0 °C at 760 mmHg
Melting Point-1.5ºC
Appearanceclear liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 925-21-3 |
| Catalog No. | 2A-9025609 |
| Chinese Name | 马来酸单丁酯 |
| Synonyms | butyl hydrogen maleate; maleic acid,butyl ester; (2Z)-4-Butoxy-4-oxobut-2-enoic acid; maleic acid N-(4-methoxyphenyl)isoimide; Maleinsaeure-monobutylester; EINECS 213-116-3; N-(4-Methoxyphenyl)-maleisoimid; 4'-Methoxyisomaleanilide; 5-(4-methoxyphenylimino)-5H-furan-2-one; N-(4-Methoxyphenyl)-maleinisoimid; MFCD00040407; maleic acid monobutyl ester; (5e)-5-[(4-methoxyphenyl)imino]furan-2(5h)-one; n-butyl maleate; (2Z)-4-Butoxy-4-oxo-2-butenoic acid |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.178 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 289.1±23.0 °C at 760 mmHg |
| Melting Point | -1.5ºC |
| Appearance | clear liquid |
| Storage Condition | Sealed and refrigerated |
| HTC | 2918990090 |
| SMILES | CCCCOC(=O)C=CC(=O)O |
| InChI | InChI=1S/C8H12O4/c1-2-3-6-12-8(11)5-4-7(9)10/h4-5H,2-3,6H2,1H3,(H,9,10)/b5-4- |
| InChI Key | UTOVMEACOLCUCK-PLNGDYQASA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-Methylolacrylamide | 924-42-5 | 2A-9025602 |
| Ethyl glyoxalate | 924-44-7 | 2A-9025603 |
| Methyl 3-methyl-2-butenoate | 924-50-5 | 2A-9025604 |
| Diisobutyl succinate | 925-06-4 | 2A-9025607 |
| Dipropyl succinate | 925-15-5 | 2A-9025608 |
| Diethyl 2,2'-thiodiacetate | 925-47-3 | 2A-9025610 |
| 3-Nonanone | 925-78-0 | 2A-9025611 |
| Ethylmagnesium bromide | 925-90-6 | 2A-0201273 |
| Dimethyl-N-propylamine | 926-63-6 | 2A-9025613 |
| Dimethylaminoacetonitrile | 926-64-7 | 2A-9025614 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA