
CAS Number868-85-9
Synonymsdimethyl H-phosphonate; Dimethylfosfit; Dimethyl phosphonate; dimethyl hydrogen phosphonate; Dimethylfosfonat; monomethyl methyl phosphonate; dimethylacidphosphite; phosphonic acid dimethyl ester; DIMETHYL PHOSPHITE; O,O-dimethyl phosphonate; (CH3O)2PHO; Phosphonic acid, dimethyl ester; Dimethylphosphit; EINECS 212-783-8; MFCD00044633
Molecular FormulaC2H7O3P
Molecular Weight192.11
Purity≥96 (HPLC)%
Density1.2 g/mL at 25 °C(lit.)
Boiling Point170.5±0.0 °C at 760 mmHg
Appearanceliquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 868-85-9 |
| Catalog No. | 2A-9025452 |
| Chinese Name | 亚磷酸二甲酯 |
| Synonyms | dimethyl H-phosphonate; Dimethylfosfit; Dimethyl phosphonate; dimethyl hydrogen phosphonate; Dimethylfosfonat; monomethyl methyl phosphonate; dimethylacidphosphite; phosphonic acid dimethyl ester; DIMETHYL PHOSPHITE; O,O-dimethyl phosphonate; (CH3O)2PHO; Phosphonic acid, dimethyl ester; Dimethylphosphit; EINECS 212-783-8; MFCD00044633 |
| Molecular Formula | C2H7O3P |
| Molecular Weight | 192.11 |
| Purity | ≥96 (HPLC) |
| Density | 1.2 g/mL at 25 °C(lit.) |
| Boiling Point | 170.5±0.0 °C at 760 mmHg |
| Appearance | liquid |
| Storage Condition | Store under dry inert gas, keep container sealed, |
| Packaging | III |
| HTC | 2920901300 |
| PubChem ID | 329765588 |
| MDL Number | MFCD07368360 |
| SMILES | COP(=O)(OC)C(=[N+]=[N-])C(C)=O |
| InChI | 1S/C5H9N2O4P/c1-4(8)5(7-6)12(9,10-2)11-3/h1-3H3 |
| InChI Key | SQHSJJGGWYIFCD-UHFFFAOYSA-N |
| Beilstein/REAXYS | 4247670 |
| NACRES Code | NA.22 |
| UNSPSC | 12352108 |
| Hazard Symbols | 3.2 |
| MSDS | msds/25452_1_868_85_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Sodium D-pantothenate | 867-81-2 | 2A-9025444 |
| Sodium tartrate | 868-18-8 | 2A-9025446 |
| Methyl 2-methylbutyrate | 868-57-5 | 2A-9025447 |
| Diethyl 2,6-dibromoheptanedioate | 868-68-8 | 2A-9025449 |
| S,S'-Dimethyl dithiocarbonate | 868-84-8 | 2A-9025451 |
| 2-Diethylaminoethylchloride hydrochloride | 869-24-9 | 2A-9025455 |
| 4-(Methylamino)pent-3-en-2-one | 869-74-9 | 2A-9025456 |
| Di-n-octyltin oxide | 870-08-6 | 2A-9025457 |
| 2-Chloroethylamine hydrochloride | 870-24-6 | 2A-9025459 |
| Ethyl dithioacetate | 870-73-5 | 2A-9025464 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA