
CAS Number824-45-3
SynonymsMFCD00000902; EINECS 212-529-6; 2-(Chloromethyl)-1,4-DiMethyl-Benzene; Benzene,2-(chloromethyl)-1,4-dimethyl; 2-(Chloromethyl)-1,4-dimethylbenzene; 2,4-DIMETHYLPHENYLMETHYLSULFONE; 1-chloromethyl-2,5-dimethylbenzene; 2,5-dimethyl-1-chloromethylbenzene; Benzenemethanol,2-bromo-5-fluoro; 2,5-Dimethylbenzyl chloride; 1-Chlormethyl-2,5-dimethylbenzol; 1,4-dimethyl-2-(chloromethyl)benzene; 2,5-Dimethylbenzylchloride
Molecular FormulaC9H11Cl
Molecular Weight154.637
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point220.9±9.0 °C at 760 mmHg
AppearanceClear colorless liquid with chlorine-like odor
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 824-45-3 |
| Catalog No. | 2A-9025335 |
| Chinese Name | 2,5-二甲基苯甲基氯 |
| Synonyms | MFCD00000902; EINECS 212-529-6; 2-(Chloromethyl)-1,4-DiMethyl-Benzene; Benzene,2-(chloromethyl)-1,4-dimethyl; 2-(Chloromethyl)-1,4-dimethylbenzene; 2,4-DIMETHYLPHENYLMETHYLSULFONE; 1-chloromethyl-2,5-dimethylbenzene; 2,5-dimethyl-1-chloromethylbenzene; Benzenemethanol,2-bromo-5-fluoro; 2,5-Dimethylbenzyl chloride; 1-Chlormethyl-2,5-dimethylbenzol; 1,4-dimethyl-2-(chloromethyl)benzene; 2,5-Dimethylbenzylchloride |
| Molecular Formula | C9H11Cl |
| Molecular Weight | 154.637 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 220.9±9.0 °C at 760 mmHg |
| Appearance | Clear colorless liquid with chlorine-like odor |
| Water Solubility | insoluble |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| Packaging | II |
| HTC | 2903999090 |
| SMILES | Cc1ccc(C)c(CCl)c1 |
| InChI | InChI=1S/C9H11Cl/c1-7-3-4-8(2)9(5-7)6-10/h3-5H,6H2,1-2H3 |
| InChI Key | PECXPZGFZFGDRD-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/25335_2_824_45_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Class 8 Corrosives UN number: 3265 Proper shipping name: Corrosive Liquid, Acidic, Organic, Not Otherwise Specified Packing grade: III |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Chlorocyclohexanone | 822-87-7 | 2A-9025321 |
| delta-Hexalactone | 823-22-3 | 2A-9025322 |
| 3,6-Dichloropyridazin-4-amine | 823-58-5 | 2A-9025326 |
| 1-Cyclohexylethan-1-one | 823-76-7 | 2A-9025327 |
| 4-Chlorophenylhydroxylamine | 823-86-9 | 2A-9025331 |
| 2-Methoxyhydroquinone | 824-46-4 | 2A-9025336 |
| Phenylphosphonic dichloride | 824-72-6 | 2A-9025341 |
| 3-Methoxybenzyl chloride | 824-98-6 | 2A-9025346 |
| 2-Amino-3-fluorobenzoic acid | 825-22-9 | 2A-9025347 |
| Sodium 4-hydroxybenzenesulfonate | 825-90-1 | 2A-9025351 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA