CAS Number815-82-7
SynonymsDL-Tartaric acid; copper,(2R,3R)-2,3-dihydroxybutanedioate; 2,3-Dihydroxy-succinic acid; 2,3-dihydroxysuccinic acid; 2,3-dihydroxybutanedioic acid; Tartaric acid; EINECS 212-425-0; MFCD00150650
Molecular Formula[-CH(OH)CO2]2Cu·xH2O
Molecular Weight211.62 (anhydrous basis)
Purity99.9 trace metals basis%
Density1.9±0.1 g/cm3
Boiling Point399.3±42.0 °C at 760 mmHg
Melting Point~275 °C (dec.) (lit.)
Appearancesolid
EINECS212-425-0
Please Login or Create an Account to: See VlP prices and availability
US Stock: ship in 0-1 business day
Global Stock: ship in 5-7 days
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 815-82-7 |
| Catalog No. | 2A-9025293 |
| Chinese Name | 酒石酸铜(II) 水合物 |
| Synonyms | DL-Tartaric acid; copper,(2R,3R)-2,3-dihydroxybutanedioate; 2,3-Dihydroxy-succinic acid; 2,3-dihydroxysuccinic acid; 2,3-dihydroxybutanedioic acid; Tartaric acid; EINECS 212-425-0; MFCD00150650 |
| Molecular Formula | [-CH(OH)CO2]2Cu·xH2O |
| Molecular Weight | 211.62 (anhydrous basis) |
| Purity | 99.9 trace metals basis |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 399.3±42.0 °C at 760 mmHg |
| Melting Point | ~275 °C (dec.) (lit.) |
| Appearance | solid |
| Water Solubility | slightly soluble |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| EINECS | 212-425-0 |
| PubChem ID | 24873739 |
| MDL Number | MFCD31010394 |
| SMILES | O.[Cu++].O[C@H]([C@@H](O)C([O-])=O)C([O-])=O |
| InChI | 1S/C4H6O6.Cu.H2O/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;1H2/q;+2;/p-2/t1-,2-;;/m1../s1 |
| InChI Key | MAUZTCHAIPUZJB-OLXYHTOASA-L |
| Beilstein/REAXYS | 4166088 |
| NACRES Code | NA.23 |
| UNSPSC | 12352302 |
| MSDS | msds/25293_1_815_82_7.pdf |
| Transport Info | Product name: Copper (II) tartrate hydrate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Cupric oxalate | 814-91-5 | 2A-9025288 |
| Stannous oxalate | 814-94-8 | 2A-9025289 |
| Strontium oxalate | 814-95-9 | 2A-9025290 |
| N-Methyl-2,2,2-trifluoroacetamide | 815-06-5 | 2A-9025291 |
| 3,3-Dimethyl-2-oxobutyric acid | 815-17-8 | 2A-9025292 |
| Methallyl methacrylate | 816-74-0 | 2A-9025295 |
| Diisopentyl succinate | 818-04-2 | 2A-9025298 |
| Dibutyltin oxide | 818-08-6 | 2A-9025299 |
| Diethyl glutarate | 818-38-2 | 2A-9025300 |
| 1-Octyn-3-ol | 818-72-4 | 2A-9025302 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS