
CAS Number1835-02-5
Synonyms2-brom-1-(3,4-dimethoxyphenyl)ethanon; 3,4-Dimethoxyphenacyl bromide; 1-(3,4-dimethoxyphenyl)-2-bromoethanone; 2-bromo-l-(3,4-dimethoxyphenyl)-ethanone; 1-(3,4-dimethoxyphenyl)-2-bromoethan-1-one; 2-Bromo-1-(3,4-dimethoxyphenyl)ethanone; MFCD03425186; 2-Bromo-1-(3,4-dimethoxy-phenyl)-ethanone
Molecular FormulaC10H11O3Br1
Molecular Weight259.1
Purity98%
Density1.4±0.1 g/cm3
Boiling Point326.5±27.0 °C at 760 mmHg
Melting Point81-83ºC
Appearanceoff-white solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1835-02-5 |
| Catalog No. | 2A-9002524 |
| Chinese Name | 溴代-3,4-二甲氧基苯乙酮 |
| Synonyms | 2-brom-1-(3,4-dimethoxyphenyl)ethanon; 3,4-Dimethoxyphenacyl bromide; 1-(3,4-dimethoxyphenyl)-2-bromoethanone; 2-bromo-l-(3,4-dimethoxyphenyl)-ethanone; 1-(3,4-dimethoxyphenyl)-2-bromoethan-1-one; 2-Bromo-1-(3,4-dimethoxyphenyl)ethanone; MFCD03425186; 2-Bromo-1-(3,4-dimethoxy-phenyl)-ethanone |
| Molecular Formula | C10H11O3Br1 |
| Molecular Weight | 259.1 |
| Purity | 98 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 326.5±27.0 °C at 760 mmHg |
| Melting Point | 81-83ºC |
| Appearance | off-white solid |
| Storage Condition | Room Temperature |
| HTC | 2914700090 |
| MDL Number | MFCD03425186 |
| SMILES | COc1ccc(C(=O)CBr)cc1OC |
| InChI | InChI=1S/C10H11BrO3/c1-13-9-4-3-7(8(12)6-11)5-10(9)14-2/h3-5H,6H2,1-2H3 |
| InChI Key | NUAIPKMBWNVQIM-UHFFFAOYSA-N |
| MSDS | msds/2524_1_1835_02_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Bromo-1-(2,5-dimethoxyphenyl)ethanone | 1204-21-3 | 2A-9002519 |
| 2-Bromo-1-(2,6-dichlorophenyl)ethanone | 81547-72-0 | 2A-9002520 |
| 2-Bromo-1-(2,6-dimethoxyphenyl)ethanone | 123184-19-0 | 2A-9002521 |
| 2-Bromo-1-(2-methoxyphenyl)ethanone | 31949-21-0 | 2A-9002522 |
| 2-Bromo-1-(3,4-dichlorophenyl)ethanone | 2632-10-2 | 2A-9002523 |
| 2-Bromo-1-(3,5-dichloro-2-methoxyphenyl)ethanone | 683274-78-4 | 2A-9002525 |
| 2-Bromo-1-(3,5-dihydroxyphenyl)ethanone | 62932-92-7 | 2A-9002526 |
| 2-Bromo-1-(3-bromo-4-methoxyphenyl)ethanone | 6096-83-9 | 2A-9002527 |
| 2-Bromo-1-(3-methoxyphenyl)ethanone | 5000-65-7 | 2A-9002528 |
| 2-Bromo-1-(4-chloro-2-fluoro-5-methylphenyl)-1-ethanone | 2A-102529 | 2A-9002529 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA