
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4571-25-9 |
| Catalog No. | 2A-9002518 |
| Chinese Name | 2-溴-1-(2,5-二氯苯基)乙酮 |
| Synonyms | MFCD03425179; T0513-4501; 2,5-Dichlor-phenacylbromid; 2-bromo-1-(2,5-dichloro-phenyl)-ethanone; HMS1408E09 |
| Molecular Formula | C8H5BrCl2O |
| Molecular Weight | 267.93500 |
| Purity | 98 |
| Density | 1.695g/cm3 |
| Boiling Point | 292.7ºC at 760 mmHg |
| Melting Point | 33-35ºC |
| HTC | 2914700090 |
| SMILES | O=C(CBr)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C8H5BrCl2O/c9-4-8(12)6-3-5(10)1-2-7(6)11/h1-3H,4H2 |
| InChI Key | JGILXRDUULAMPY-UHFFFAOYSA-N |
| MSDS | msds/2518_1_4571_25_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Benzylsuccinic acid | 884-33-3 | 2A-9002503 |
| 2-Biphenyl-[1,3]dioxol-5-yl-acetic acid | 2A-102507 | 2A-9002507 |
| 2-Biphenylacetonitrile | 19853-10-2 | 2A-9002514 |
| 2-Bromo-1-(2,3-dihydrobenzo[1,4]-dioxin-6-yl]ethanone | 4629-54-3 | 2A-9002516 |
| 2-Bromo-1-(2',4'-dimethoxyphenyl)ethanone | 60965-26-6 | 2A-9002517 |
| 2-Bromo-1-(2,5-dimethoxyphenyl)ethanone | 1204-21-3 | 2A-9002519 |
| 2-Bromo-1-(2,6-dichlorophenyl)ethanone | 81547-72-0 | 2A-9002520 |
| 2-Bromo-1-(2,6-dimethoxyphenyl)ethanone | 123184-19-0 | 2A-9002521 |
| 2-Bromo-1-(2-methoxyphenyl)ethanone | 31949-21-0 | 2A-9002522 |
| 2-Bromo-1-(3,4-dichlorophenyl)ethanone | 2632-10-2 | 2A-9002523 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA