![Methyl 4'-methoxy[1,1'-biphenyl]-4-carboxylate structure, CAS 729-17-9](/structures/40000/25062_1_729_17_9.png)
CAS Number729-17-9
Synonyms4-methyloxycarbonyl-4'-methoxy-1,1'-biphenyl; METHYL 4'-METHOXYBIPHENYL-4-CARBOXYLATE; methyl 4'-methoxy(1,1'-biphenyl)-4-carboxylate; 4'-Methoxybiphenyl-4-carboxylic acid methyl ester; methyl 4-(4'-methoxyphenyl)benzoate; AMTDA028; methyl 1-(4'-methoxy-biphenyl-4-yl)-carboxylate
Molecular FormulaC14H14O1
Molecular Weight198.26
Purity98.00%
Density1.118g/cm3
Boiling Point373.6ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 729-17-9 |
| Catalog No. | 2A-9025062 |
| Chinese Name | 4'-甲氧基-[1,1'-联苯]-4-羧酸甲酯 |
| Synonyms | 4-methyloxycarbonyl-4'-methoxy-1,1'-biphenyl; METHYL 4'-METHOXYBIPHENYL-4-CARBOXYLATE; methyl 4'-methoxy(1,1'-biphenyl)-4-carboxylate; 4'-Methoxybiphenyl-4-carboxylic acid methyl ester; methyl 4-(4'-methoxyphenyl)benzoate; AMTDA028; methyl 1-(4'-methoxy-biphenyl-4-yl)-carboxylate |
| Molecular Formula | C14H14O1 |
| Molecular Weight | 198.26 |
| Purity | 98.00 |
| Density | 1.118g/cm3 |
| Boiling Point | 373.6ºC at 760 mmHg |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2922299090 |
| MDL Number | MFCD00671952 |
| SMILES | COC(=O)c1ccc(-c2ccc(OC)cc2)cc1 |
| InChI Key | YJOVQAHQGZBWIU-UHFFFAOYSA-N |
| MSDS | msds/25062_1_729_17_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-(Trifluoromethyl)phenylacetylene | 705-31-7 | 2A-9024999 |
| 1,3,5-Trimethyl-2-(trichloromethyl)benzene | 707-74-4 | 2A-9025014 |
| 4,6-Dimethoxysalicylaldehyde | 708-76-9 | 2A-9025017 |
| Adamantane-1-carboxylic acid methyl ester | 711-01-3 | 2A-9025026 |
| 4-(Trifluoromethyl)benzeneacetic acid ethyl ester | 721-63-1 | 2A-9025052 |
| 1,3,5-Tris(trifluoromethyl)benzene | 729-81-7 | 2A-9025063 |
| Cyclopenthiazide | 742-20-1 | 2A-9025072 |
| Diethyl acetylenedicarboxylate | 762-21-0 | 2A-9025105 |
| Pyrazinoic acid hydrazide | 768-05-8 | 2A-9025163 |
| 5-Nitro-2-norbornene | 768-16-1 | 2A-9025165 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA