
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 710-11-2 |
| Catalog No. | 2A-9025024 |
| Chinese Name | 2-氧代-4-苯基丁酸 |
| Synonyms | 2-Oxo-4-phenylbutanoic acid; MFCD00969471; EINECS 211-916-7 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.185 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 314.4±21.0 °C at 760 mmHg |
| Melting Point | 47.0 to 51.0 deg-C |
| Appearance | white crystal |
| Storage Condition | 2~8°C, sealed |
| HTC | 2918300090 |
| SMILES | O=C(O)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C10H10O3/c11-9(10(12)13)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,12,13) |
| InChI Key | PPKAIMDMNWBOKN-UHFFFAOYSA-N |
| MSDS | msds/25024_1_710_11_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 2-Oxo-4-phenylbutyric acid Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,5-Dimethyl-1-adamantanol | 707-37-9 | 2A-9025011 |
| 4-Bromo-N,N-dimethylbenzenesulfonamide | 707-60-8 | 2A-9025012 |
| 4,5-Dihydro-3-methyl-1-phenyl-1H-phosphole 1-oxide | 707-61-9 | 2A-9025013 |
| 3,4-Dimethoxynitrobenzene | 709-09-1 | 2A-9025018 |
| Undecanolactone | 710-04-3 | 2A-9025023 |
| 4-(Trifluoromethoxy)anisole | 710-18-9 | 2A-9025025 |
| 4-Phenylbenzylamine | 712-76-5 | 2A-9025028 |
| Methyl 3-hydroxy-4-nitrobenzoate | 713-52-0 | 2A-9025029 |
| delta-Dodecalactone | 713-95-1 | 2A-9025031 |
| 3-Bromophenanthrene | 715-50-4 | 2A-9025032 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA