
CAS Number632-16-6
SynonymsThiophene,2,3-dimethyl; MFCD00130081; EINECS 211-170-2; 2,3-Dimethyl-thiophen; 2.3-Dimethyl-thiophene; dimethylthiophene
Molecular FormulaC6H8S
Molecular Weight112.19300
Purity98.00%
Density1.006 g/cm3
Boiling Point144.6ºC at 760 mmHg
Melting Point-49ºC
AppearanceTransparent colorless to yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 632-16-6 |
| Catalog No. | 2A-9024606 |
| Chinese Name | 2,3-二甲基噻吩 |
| Synonyms | Thiophene,2,3-dimethyl; MFCD00130081; EINECS 211-170-2; 2,3-Dimethyl-thiophen; 2.3-Dimethyl-thiophene; dimethylthiophene |
| Molecular Formula | C6H8S |
| Molecular Weight | 112.19300 |
| Purity | 98.00 |
| Density | 1.006 g/cm3 |
| Boiling Point | 144.6ºC at 760 mmHg |
| Melting Point | -49ºC |
| Appearance | Transparent colorless to yellow liquid |
| Storage Condition | Store in a cool, ventilated warehouse. Keep away f |
| HTC | 2934999090 |
| SMILES | Cc1ccsc1C |
| InChI | InChI=1S/C6H8S/c1-5-3-4-7-6(5)2/h3-4H,1-2H3 |
| InChI Key | BZYUMXXOAYSFOW-UHFFFAOYSA-N |
| MSDS | msds/24606_1_632_16_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2,5-Dimethylpyrrole | 625-84-3 | 2A-9024487 |
| 2,5-Dimethylfuran | 625-86-5 | 2A-9024489 |
| 3-Methylpiperidine | 626-56-2 | 2A-9024516 |
| N-Methylpiperidine | 626-67-5 | 2A-9024520 |
| Pyridine hydrochloride | 628-13-7 | 2A-9024551 |
| Pyrrole-2-carboxylic acid | 634-97-9 | 2A-9024630 |
| 5-Chloroquinoline | 635-27-8 | 2A-9024634 |
| Guanine hydrochloride | 635-39-2 | 2A-9024636 |
| 2-Methyl-6-quinolinecarboxylic acid | 635-80-3 | 2A-9024640 |
| 4-Hydroxy-5-methyl-2-mercaptopyrimidine | 636-26-0 | 2A-9024643 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA