
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 626-27-7 |
| Catalog No. | 2A-9024507 |
| Chinese Name | 庚酸酐 |
| Synonyms | MFCD00009536; heptanoyl heptanoate; EINECS 210-940-5 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 |
| Purity | 98.00 |
| Density | 0.917 |
| Boiling Point | 278-282 °C |
| Melting Point | -12 °C |
| Appearance | Transparent light yellow liquid |
| Storage Condition | Store in an airtight container in a cool, dry plac |
| Packaging | III |
| HTC | 2915900090 |
| MDL Number | MFCD00009536 |
| SMILES | CCCCCCC(=O)OC(=O)CCCCCC |
| InChI | InChI=1S/C14H26O3/c1-3-5-7-9-11-13(15)17-14(16)12-10-8-6-4-2/h3-12H2,1-2H3 |
| InChI Key | DAPZDAPTZFJZTO-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/24507_1_626_27_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Class 8 Corrosives UN number: 3265 Proper shipping name: Corrosive Liquid, Acidic, Organic, Not Otherwise Specified Packing grade: III |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Iodoaniline | 626-01-7 | 2A-9024494 |
| 3,3'-Dimethyldiphenylamine | 626-13-1 | 2A-9024499 |
| 1,3-Dicyanobenzene | 626-17-5 | 2A-9024502 |
| 1,3-Phenylenediacetonitrile | 626-22-2 | 2A-9024505 |
| Di-sec-butylamine | 626-23-3 | 2A-9024506 |
| Ethyl nitroacetate | 626-35-7 | 2A-9024508 |
| 1,3,5-Tribromobenzene | 626-39-1 | 2A-9024509 |
| 3,5-Dibromoaniline | 626-40-4 | 2A-9024510 |
| 3,5-Dibromophenol | 626-41-5 | 2A-9024511 |
| 3-Methylglutaric acid | 626-51-7 | 2A-9024514 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA