
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 622-03-7 |
| Catalog No. | 2A-9024379 |
| Chinese Name | 二苯基硫卡巴肼 |
| Synonyms | EINECS 210-717-2; 1,3-dianilinothiourea; MFCD00046042 |
| Molecular Formula | C13H14N4S |
| Molecular Weight | 258.34200 |
| Purity | 98.00 |
| Density | 1.322g/cm3 |
| Boiling Point | 383.9ºC at 760 mmHg |
| Melting Point | 155°C |
| Appearance | Solid;White to Gray to Brown powder to crystal |
| Water Solubility | Slightly soluble: ethanol |
| Storage Condition | 0-10°C; store in inert gas; avoid light, air, heat |
| HTC | 2930909090 |
| SMILES | S=C(NNc1ccccc1)NNc1ccccc1 |
| InChI Key | BNSNUHPJRKTRNT-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2930909090. other organo-sulfur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| Ethyl 2-oxocyclopentanecarboxylate | 611-10-9 | 2A-9024127 |
| 2-Ethoxybenzaldehyde | 613-69-4 | 2A-9024186 |
| Acetophenone oxime | 613-91-2 | 2A-9024191 |
| Chloroacetaldehyde diethyl acetal | 621-62-5 | 2A-9024369 |
| (+)-Dibenzyl L-tartrate | 622-00-4 | 2A-9024378 |
| alpha,alpha'-dichloro-p-xylene;1,4-Bis(chloromethyl)benzene | 623-25-6 | 2A-9024416 |
| 1,4-Phthalaldehyde | 623-27-8 | 2A-9024418 |
| Chloromethyl acetate | 625-56-9 | 2A-9024481 |
| 1,3-Bis(bromomethyl)benzene | 626-15-3 | 2A-9024500 |
| 1,3-Bis(chloromethyl)benzene | 626-16-4 | 2A-9024501 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA