
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 613-50-3 |
| Catalog No. | 2A-9024182 |
| Chinese Name | 6-硝基喹啉 |
| Synonyms | EINECS 210-346-6; MFCD00006799; 6-Nitroquinoline |
| Molecular Formula | C9H6N2O2 |
| Molecular Weight | 174.16 |
| Purity | 98 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 335.4±15.0 °C at 760 mmHg |
| Melting Point | 151-153 °C (lit.) |
| Appearance | powder |
| Water Solubility | Water solubility: slightly soluble; soluble in: be |
| Storage Condition | Storage: Seal the container and store it in a seal |
| EINECS | 210-346-6 |
| HTC | 2933499090 |
| PubChem ID | 24897572 |
| MDL Number | MFCD00006799 |
| SMILES | [O-][N+](=O)c1ccc2ncccc2c1 |
| InChI | 1S/C9H6N2O2/c12-11(13)8-3-4-9-7(6-8)2-1-5-10-9/h1-6H |
| InChI Key | SMHPLBXIVNQFBA-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/24182_1_613_50_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4-Chloroquinoline | 611-35-8 | 2A-9024136 |
| 6-Chloroquinoline | 612-57-7 | 2A-9024161 |
| 3-Chloroquinoline | 612-59-9 | 2A-9024163 |
| 7-Chloroquinoline | 612-61-3 | 2A-9024165 |
| 2-Phenylquinoline | 612-96-4 | 2A-9024171 |
| 7-Nitroquinoline | 613-51-4 | 2A-9024183 |
| 5-Methylbenzimidazole | 614-97-1 | 2A-9024212 |
| 2-Methylbenzimidazole | 615-15-6 | 2A-9024217 |
| 2-Chlorobenzoxazole | 615-18-9 | 2A-9024219 |
| 2-Methylmercaptobenzothiazole | 615-22-5 | 2A-9024222 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA